@charset "UTF-8";
    .clearfix:after {
        content: "";
        display: block;
        clear: both
    }

    html {
        font-family: sans-serif;
        -ms-text-size-adjust: 100%;
        -webkit-text-size-adjust: 100%
    }

    body {
        margin: 0
    }

    article,
    aside,
    details,
    figcaption,
    figure,
    footer,
    header,
    hgroup,
    main,
    menu,
    nav,
    section,
    summary {
        display: block
    }

    audio,
    canvas,
    progress,
    video {
        display: inline-block;
        vertical-align: baseline
    }

    audio:not([controls]) {
        display: none;
        height: 0
    }

    [hidden],
    template {
        display: none
    }

    a {
        background-color: transparent
    }

    a:active,
    a:hover {
        outline: 0
    }

    abbr[title] {
        border-bottom: 1px dotted
    }

    dfn {
        font-style: italic
    }

    h1 {
        font-size: 2em;
        margin: .67em 0
    }

    mark {
        background: #ff0;
        color: #000
    }

    small {
        font-size: 80%
    }

    sub,
    sup {
        font-size: 75%;
        line-height: 0;
        position: relative;
        vertical-align: baseline
    }

    sup {
        top: -.5em
    }

    sub {
        bottom: -.25em
    }

    img {
        border: 0
    }

    svg:not(:root) {
        overflow: hidden
    }

    figure {
        margin: 1em 40px
    }

    hr {
        box-sizing: content-box;
        height: 0
    }

    pre {
        overflow: auto
    }

    code,
    kbd,
    pre,
    samp {
        font-family: monospace, monospace;
        font-size: 1em
    }

    button,
    input,
    optgroup,
    select,
    textarea {
        color: inherit;
        font: inherit;
        margin: 0
    }

    button {
        overflow: visible
    }

    button,
    select {
        text-transform: none
    }

    button,
    html input[type=button],
    input[type=reset],
    input[type=submit] {
        -webkit-appearance: button;
        cursor: pointer
    }

    button[disabled],
    html input[disabled] {
        cursor: default
    }

    button::-moz-focus-inner,
    input::-moz-focus-inner {
        border: 0;
        padding: 0
    }

    input {
        line-height: normal
    }

    input[type=checkbox],
    input[type=radio] {
        box-sizing: border-box;
        padding: 0
    }

    input[type=number]::-webkit-inner-spin-button,
    input[type=number]::-webkit-outer-spin-button {
        height: auto
    }

    input[type=search] {
        -webkit-appearance: textfield;
        box-sizing: content-box
    }

    input[type=search]::-webkit-search-cancel-button,
    input[type=search]::-webkit-search-decoration {
        -webkit-appearance: none
    }

    fieldset {
        border: 1px solid silver;
        margin: 0 2px;
        padding: .35em .625em .75em
    }

    legend {
        border: 0;
        padding: 0
    }

    textarea {
        overflow: auto
    }

    optgroup {
        font-weight: 700
    }

    table {
        border-collapse: collapse;
        border-spacing: 0
    }

    td,
    th {
        padding: 0
    }

    *,
    :after,
    :before {
        box-sizing: inherit
    }

    html {
        box-sizing: border-box;
        font-size: 112.5%;
        line-height: 1.33333;
        height: 100%
    }

    body {
        position: relative;
        overflow-x: hidden;
        min-width: 320px;
        min-height: 100%;
        font-family: brandon-grotesque, Helvetica, Arial, sans-serif;
        color: #505c69;
        background: #fff
    }

    body.is-locked {
        overflow: hidden
    }

    img {
        vertical-align: middle
    }

    img,
    svg {
        max-width: 100%
    }

    h1,
    h2,
    h3,
    h4,
    h5,
    h6 {
        margin: 0;
        font-weight: 400
    }

    h1 {
        font-size: 42px
    }

    h1,
    h2 {
        line-height: 42px
    }

    h2 {
        font-size: 34px
    }

    h3 {
        font-size: 26px;
        line-height: 30px
    }

    h4,
    h5,
    h6 {
        font-size: 18px;
        line-height: 24px
    }

    @media(min-width:48em) {
        h1 {
            font-size: 50px;
            line-height: 54px
        }
        h2 {
            font-size: 42px
        }
        h2,
        h3 {
            line-height: 42px
        }
        h3 {
            font-size: 34px
        }
        h4,
        h5,
        h6 {
            font-size: 26px;
            line-height: 30px
        }
    }

    p {
        margin: 0
    }

    dl,
    ol,
    ul {
        margin: 0;
        padding: 0;
        list-style: none
    }

    a {
        color: #0075bc;
        text-decoration: none
    }

    a:focus,
    a:hover {
        color: #004d7d
    }

    hr {
        padding: 12px 0;
        border: 0;
        border-bottom: 1px solid #dedede
    }

    b,
    strong {
        font-weight: 700
    }

    table th {
        text-align: left
    }

    .container,
    .wrapper {
        margin: 0 auto
    }

    .wrapper {
        max-width: 1570px;
        padding: 0 24px
    }

    @media(min-width:48em) {
        .wrapper {
            padding: 0 48px
        }
    }

    .logo {
        transition: all .15s ease-in
    }

    .logo:focus,
    .logo:hover {
        opacity: .7
    }

    .logo--narrow {
        display: block
    }

    .logo--narrow img {
        width: 100%;
        max-width: 170px
    }

    .btn,
    .logo--centered {
        text-align: center
    }

    .btn {
        display: inline-block;
        vertical-align: middle;
        -ms-touch-action: manipulation;
        touch-action: manipulation;
        -webkit-user-select: none;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none;
        cursor: pointer;
        white-space: nowrap;
        text-decoration: none;
        border: 0;
        background: transparent;
        transition: all .15s ease-in-out;
        font-family: brandon-grotesque, Helvetica, Arial, sans-serif;
        font-weight: 300;
        text-transform: uppercase;
        letter-spacing: .2em
    }

    .btn:focus {
        outline: 0
    }

    .btn--primary {
        border: 1px solid #0075bc;
        color: #0075bc
    }

    .btn--primary:focus,
    .btn--primary:hover {
        background: #0075bc;
        color: #fff
    }

    .btn--primary.is-disabled:focus,
    .btn--primary.is-disabled:hover,
    .btn--primary:disabled:focus,
    .btn--primary:disabled:hover {
        background-color: transparent;
        color: #0075bc
    }

    .btn--secondary {
        border: 1px solid green;
        color: green
    }

    .btn--secondary:focus,
    .btn--secondary:hover {
        background: green;
        color: #fff
    }

    .btn--secondary.is-disabled:focus,
    .btn--secondary.is-disabled:hover,
    .btn--secondary:disabled:focus,
    .btn--secondary:disabled:hover {
        background-color: transparent;
        color: green
    }

    .btn--neutral {
        border: 1px solid #8e8e8e;
        color: #8e8e8e
    }

    .btn--neutral:focus,
    .btn--neutral:hover {
        background: #8e8e8e;
        color: #fff
    }

    .btn--neutral.is-disabled:focus,
    .btn--neutral.is-disabled:hover,
    .btn--neutral:disabled:focus,
    .btn--neutral:disabled:hover {
        background-color: transparent;
        color: green
    }

    .btn--negative {
        background-color: transparent;
        border: 1px solid #fff;
        color: #fff
    }

    .btn--negative:focus,
    .btn--negative:hover {
        border: 1px solid hsla(0, 0%, 100%, .6);
        color: hsla(0, 0%, 100%, .6)
    }

    .btn--negative.is-disabled:focus,
    .btn--negative.is-disabled:hover,
    .btn--negative:disabled:focus,
    .btn--negative:disabled:hover {
        background-color: transparent;
        color: #fff
    }

    .btn--ghost {
        background-color: transparent;
        color: #0075bc
    }

    .btn--ghost:focus,
    .btn--ghost:hover {
        color: #0065a3
    }

    .btn--ghost.is-disabled:focus,
    .btn--ghost.is-disabled:hover,
    .btn--ghost:disabled:focus,
    .btn--ghost:disabled:hover {
        background-color: transparent;
        color: #0075bc
    }

    .btn--ghost--negative {
        background-color: transparent;
        color: #fff
    }

    .btn--ghost--negative:focus,
    .btn--ghost--negative:hover {
        color: hsla(0, 0%, 100%, .7)
    }

    .btn--ghost--negative.is-disabled:focus,
    .btn--ghost--negative.is-disabled:hover,
    .btn--ghost--negative:disabled:focus,
    .btn--ghost--negative:disabled:hover {
        background-color: transparent;
        color: #fff
    }

    .btn.is-disabled,
    .btn:disabled {
        cursor: not-allowed;
        opacity: .6;
        background-color: transparent
    }

    .btn.is-disabled {
        pointer-events: none
    }

    .btn--sml {
        font-size: 14px;
        height: 24px;
        line-height: 24px;
        padding: 0 12px
    }

    .btn--med {
        font-size: 16px;
        line-height: 24px;
        height: 36px;
        line-height: 36px;
        padding: 0 18px
    }

    .btn--lrg {
        height: 48px;
        line-height: 48px;
        padding: 0 24px
    }

    .btn-spacer {
        padding: 0 6px;
        font-size: 14px;
        line-height: 18px;
        text-transform: uppercase;
        letter-spacing: .15em;
        color: #aaa
    }

    .btn--nopadding {
        padding-right: 0;
        padding-left: 0
    }

    .btn--shortened {
        max-width: 120px;
        white-space: nowrap;
        overflow: hidden;
        text-overflow: ellipsis
    }

    .btn--active {
        background: #0075bc;
        color: #fff
    }

    .btn-group {
        display: inline-block
    }

    .btn-group:after {
        content: "";
        display: block;
        clear: both
    }

    .btn-group--radial .btn:first-child {
        border-radius: 4px 0 0 4px
    }

    .btn-group--radial .btn:last-child {
        border-radius: 0 4px 4px 0
    }

    .btn-group--rounded .btn:first-child {
        border-radius: 1000px 0 0 1000px
    }

    .btn-group--rounded .btn:last-child {
        border-radius: 0 1000px 1000px 0
    }

    .btn-group .btn {
        float: left
    }

    .btn-group .btn + .btn {
        margin-left: -1px
    }

    .status {
        display: inline-block
    }

    .status--warning {
        background: #f55a4f;
        color: #fff
    }

    .status--success {
        background: #66b068;
        color: #fff
    }

    .status--note {
        background: #e3c25e;
        color: #fff
    }

    .status--sml {
        font-size: 14px;
        min-height: 24px;
        line-height: 24px;
        padding: 0 12px
    }

    .status--med {
        font-size: 16px;
        line-height: 24px;
        min-height: 36px;
        line-height: 36px;
        padding: 0 18px
    }

    .status--lrg {
        min-height: 48px;
        line-height: 48px;
        padding: 0 24px
    }

    .input {
        padding: 0;
        margin: 0;
        border: 0;
        border-radius: 0;
        display: inline-block;
        vertical-align: middle;
        width: 100%;
        border-bottom: 1px solid #c4c4c4;
        -webkit-border-radius: 0;
        cursor: pointer;
        white-space: nowrap;
        text-decoration: none;
        font-family: brandon-grotesque, Helvetica, Arial, sans-serif;
        background: transparent
    }

    .input:focus {
        border-color: #0075bc;
        outline: 0
    }

    .input--sml {
        font-size: 16px;
        height: 24px;
        line-height: 24px
    }

    .input--sml--padded {
        padding-right: 12px;
        padding-left: 12px
    }

    .input--med {
        height: 36px;
        line-height: 36px
    }

    .input--med--padded {
        padding-right: 18px;
        padding-left: 18px
    }

    .input--lrg {
        height: 48px;
        line-height: 48px
    }

    .input--lrg--padded {
        padding-right: 24px;
        padding-left: 24px
    }

    .input--number {
        padding-right: 0
    }

    .input--select--multiple {
        min-height: 160px
    }

    .input--textarea {
        min-height: 160px;
        resize: vertical;
        border: 1px solid #c4c4c4;
        padding: 0 12px
    }

    .input--fileupload {
        padding: 24px
    }

    .input--check,
    .input--radio {
        position: absolute;
        left: -99999px;
        opacity: 0
    }

    .input--check + input[type=hidden] + input[type=hidden] + label,
    .input--check + input[type=hidden] + label,
    .input--radio + input[type=hidden] + input[type=hidden] + label,
    .input--radio + input[type=hidden] + label {
        padding-left: 12px
    }

    .input--check + input[type=hidden] + input[type=hidden] + label:before,
    .input--check + input[type=hidden] + label:before,
    .input--radio + input[type=hidden] + input[type=hidden] + label:before,
    .input--radio + input[type=hidden] + label:before {
        content: '';
        display: block;
        float: left;
        width: 15px;
        height: 15px;
        margin-top: 3px;
        transition: all .2s ease-in-out;
        border: 1px solid #c4c4c4
    }

    .input--check:focus + input[type=hidden] + input[type=hidden] + label:before,
    .input--check:focus + input[type=hidden] + label:before,
    .input--radio:focus + input[type=hidden] + input[type=hidden] + label:before,
    .input--radio:focus + input[type=hidden] + label:before {
        box-shadow: 0 0 5px #0075bc
    }

    .input--check:checked + input[type=hidden] + input[type=hidden] + label:before,
    .input--check:checked + input[type=hidden] + label:before,
    .input--radio:checked + input[type=hidden] + input[type=hidden] + label:before,
    .input--radio:checked + input[type=hidden] + label:before {
        background: #0075bc;
        border-color: transparent
    }

    /*  one button design  */
    .custom-file-input::-webkit-file-upload-button {
        background: transparent;
        border:1px solid rgb(0,117,188);
        font-size: 20px;
        background: transparent;
        border:1px solid rgb(0,117,188);
        font-size: 20px;
        border-radius: 1000px;
        padding: 0 18px;
        font-size: 16px;
        line-height: 36px;
        height: 36px;
        padding: 0 18px;
        font-size: 16px;
        line-height: 36px;
        height: 36px;
        vertical-align: middle;
        touch-action: manipulation;
        color:rgb(0,117,188);
        text-transform: uppercase;
    }
    .custom-file-input::-webkit-file-upload-button:hover{
        background-color: rgb(0,117,188);
        color:white;
        cursor: pointer;
        transition:.5s;

    }
    .custom-file-input{
        font-size:16px;
        font-family: brandon-grotesque, Helvetica, Arial, sans-serif!important;
    }
    .custom-upload-file{
        background: transparent;
        border:1px solid rgb(0,117,188);
        font-size: 20px;
        background: transparent;
        border:1px solid rgb(0,117,188);
        font-size: 20px;
        border-radius: 1000px;
        padding: 0 18px;
        font-size: 16px;
        line-height: 36px;
        height: 36px;
        padding: 0 18px;
        font-size: 16px;
        line-height: 36px;
        height: 36px;
        vertical-align: middle;
        touch-action: manipulation;
        color:rgb(0,117,188);
        font-family: brandon-grotesque, Helvetica, Arial, sans-serif!important;
        transition:.5s;
        text-transform: uppercase;
    }
    .upload-absolute{
        position: absolute;
        top: 0.9%;
        right: 2.5%;;
    }
    .custom-upload-file:hover{
        background-color: rgb(0,117,188);
        color:white;
        cursor: pointer;

    }
    /*  one button design  */

    #choose_file::-webkit-file-upload-button{
        background: #dc3545;
        border:1px solid rgb(0,117,188);
        color:white;
    }
    #choose_file::-webkit-file-upload-button:hover{
        background-color: rgb(0,117,188);
        border:1px solid rgb(0,117,188);
        color:white;
    }
    .input--radio + input[type=hidden] + input[type=hidden] + label:before,
    .input--radio + input[type=hidden] + label:before {
        border-radius: 50%
    }

    .input--alternate {
        border: 0;
        background: transparent;
        padding-right: 0;
        padding-left: 0;
        border-bottom: 1px solid rgba(0, 0, 0, .2)
    }

    .input--alternate::-webkit-input-placeholder {
        color: rgba(0, 0, 0, .6)
    }

    .input--alternate::-moz-placeholder {
        color: rgba(0, 0, 0, .6)
    }

    .input--alternate:-ms-input-placeholder {
        color: rgba(0, 0, 0, .6)
    }

    .input--alternate::placeholder {
        color: rgba(0, 0, 0, .6)
    }

    .input--alternate:focus {
        border-bottom-color: rgba(0, 0, 0, .6)
    }

    .input--alternate--negative {
        color: #fff;
        border-bottom-color: #fff
    }

    .input--alternate--negative::-webkit-input-placeholder {
        color: hsla(0, 0%, 100%, .6)
    }

    .input--alternate--negative::-moz-placeholder {
        color: hsla(0, 0%, 100%, .6)
    }

    .input--alternate--negative:-ms-input-placeholder {
        color: hsla(0, 0%, 100%, .6)
    }

    .input--alternate--negative::placeholder {
        color: hsla(0, 0%, 100%, .6)
    }

    .input--alternate--negative:focus {
        border-bottom-color: hsla(0, 0%, 100%, .6)
    }

    .input--bordered {
        border: 1px solid #c4c4c4
    }

    .input-validation-error {
        border-color: #f44336!important
    }

    .field-validation-error {
        margin: 12px 0!important
    }

    .field {
        margin-bottom: 24px
    }

    .field__lbl {
        display: block;
        margin-bottom: 6px;
        font-size: 16px;
        line-height: 18px;
        color: rgba(80, 92, 105, .85)
    }

    .field__lbl--nextToInput {
        padding-top: 18px
    }

    .field__description {
        padding: 6px 0;
        font-size: 16px;
        line-height: 18px
    }

    .field__group {
        display: table
    }

    .field__group > * {
        display: table-cell;
        vertical-align: top
    }

    .field__icon {
        position: absolute;
        top: 50%;
        transform: translateY(-50%);
        pointer-events: none
    }

    .field__icon--left {
        left: 0
    }

    .field__icon--right {
        right: 0
    }

    .fieldset {
        padding: 0;
        margin: 0;
        border: 0
    }

    .fieldset__legend {
        padding: 48px 0;
        font-size: 16px;
        line-height: 24px;
        letter-spacing: .15em;
        text-transform: uppercase;
        font-weight: 700
    }

    .fieldset__legend--first {
        padding-top: 0
    }

    .alert {
        display: block;
        font-size: 16px;
        line-height: 18px
    }

    .alert--success {
        color: #4caf50
    }

    .alert--warning {
        color: #f44336
    }

    .alert--note {
        color: #e2ba45
    }

    .validation-summary {
        font-size: 16px;
        line-height: 18px;
        margin-bottom: 24px;
        padding: 12px;
        background: rgba(244, 67, 54, .7)
    }

    .validation-summary > ul > li {
        margin-bottom: 6px;
        color: #fff
    }

    .validation-summary > ul > li:last-child {
        margin-bottom: 0
    }

    .validation-summary-valid {
        display: none
    }

    .validation-summary-errors {
        display: block
    }

    .message {
        font-size: 16px;
        line-height: 24px;
        padding: 12px 24px;
        color: #fff
    }

    .message--warning {
        background-color: #f44336
    }

    .message--success {
        background-color: #4caf50
    }

    .message--note {
        background-color: #e2ba45
    }

    .layout--split__wrapper {
        display: table;
        width: 100%;
        min-height: 1024px;
        min-width: 1024px
    }

    .layout--split__sidebar {
        width: 20%;
        display: table-cell;
        vertical-align: top;
        background: #00283d;
        background: url(../images/bubbles.jpg) repeat-y
    }

    .layout--split__content {
        width: 80%;
        display: table-cell;
        vertical-align: top;
        background: #edeeef
    }

    .layout--split__body {
        padding: 36px
    }

    .layout--splitscreen {
        display: table;
        width: 100%;
        min-height: 1024px
    }

    .layout--splitscreen__sidebar {
        width: 25%;
        display: table-cell;
        vertical-align: top;
        padding-right: 24px;
        padding-bottom: 24px;
        border-right: 1px solid #d4d5d5
    }

    .layout--splitscreen__content {
        width: 75%;
        display: table-cell;
        vertical-align: top
    }

    .layout--splitscreen__body {
        padding: 24px
    }

    .layout--account {
        max-width: 600px;
        min-height: 100vh;
        margin: 0 auto;
        padding: 48px 0 0
    }

    @media(min-width:48em) {
        .layout--account {
            padding: 120px 0
        }
    }

    .layout--account__header {
        margin-bottom: 24px
    }

    .contentlayout--narrow {
        width: 40%
    }

    .smm {
        overflow: hidden
    }

    .smm__item {
        float: left;
        margin-right: 6px
    }

    .smm__link {
        display: block;
        width: 42px;
        height: 42px;
        padding: 0;
        line-height: 39px;
        text-align: center;
        border: 1px solid #0075bc;
        border-radius: 50%;
        transition: all .2s ease-in-out
    }

    .smm__link img {
        height: 30px
    }

    .smm__link:focus,
    .smm__link:hover {
        opacity: .7
    }

    .hamburger {
        padding: 0;
        border: 0;
        background: transparent;
        position: relative;
        display: block;
        width: 30px;
        height: 16.5px;
        padding: 18px
    }

    .hamburger:after,
    .hamburger:before,
    .hamburger span {
        position: absolute;
        left: 6px;
        width: 24px;
        height: 1px;
        background: #fff;
        transition: all .2s ease-in-out;
        transform: translateZ(0)
    }

    .hamburger span {
        top: 18px
    }

    .hamburger:after,
    .hamburger:before {
        content: '';
        display: block
    }

    .hamburger:after {
        bottom: 11px
    }

    .hamburger:before {
        top: 12px
    }

    .hamburger.is-open span {
        opacity: 0
    }

    .hamburger.is-open:after {
        transform: rotate(-45deg);
        bottom: 17px
    }

    .hamburger.is-open:before {
        transform: rotate(45deg);
        top: 17px
    }

    .table {
        overflow-x: auto;
        overflow-y: hidden
    }

    .table__data {
        width: 100%
    }

    .table thead {
        border-bottom: 1px solid #212125
    }

    .table td,
    .table th {
        vertical-align: top;
        padding: 12px;
        font-size: 16px;
        line-height: 24px
    }

    .table tr {
        border-bottom: 1px solid rgba(33, 33, 37, .2)
    }

    .table tr:last-child {
        border-bottom: 1px solid #212125
    }

    .table__row--emph {
        background: rgba(0, 0, 0, .1)
    }

    .formatted dl,
    .formatted img,
    .formatted object,
    .formatted ol,
    .formatted p,
    .formatted table,
    .formatted ul {
        margin-bottom: 24px
    }

    .formatted h1,
    .formatted h2,
    .formatted h3,
    .formatted h4,
    .formatted h5,
    .formatted h6 {
        margin: 48px 0
    }

    .formatted dl,
    .formatted ol,
    .formatted ul {
        list-style: inherit;
        list-style-position: inside
    }

    .formatted p {
        font-size: 18px;
        line-height: 30px
    }

    .formatted p:last-child {
        margin-bottom: 0!important
    }

    .formatted__hugephoto {
        position: relative;
        background-color: #fff;
        text-align: center
    }

    .formatted__hugephoto__photo {
        width: 100%;
        max-width: 1600px;
        margin: 0 auto
    }

    .formatted__hugephoto__copy {
        position: absolute;
        top: 50%;
        left: 50%;
        transform: translate(-50%, -50%);
        z-index: 1;
        width: 50%
    }

    .formatted__hugephoto__title {
        font-size: 26px;
        line-height: 30px;
        text-transform: uppercase;
        font-weight: 700;
        color: hsla(0, 0%, 100%, .8)
    }

    @media(min-width:48em) {
        .formatted__hugephoto__title {
            margin-bottom: 24px;
            font-size: 50px;
            line-height: 54px;
            color: #fff
        }
    }

    .formatted__hugephoto__subtitle {
        display: none
    }

    @media(min-width:48em) {
        .formatted__hugephoto__subtitle {
            display: block;
            font-size: 26px;
            line-height: 30px;
            color: hsla(0, 0%, 100%, .8)
        }
    }

    .card {
        position: relative;
        background: #fff
    }

    .card--padded {
        padding: 36px
    }

    .card--nested {
        margin: 0 -36px;
        padding: 54px;
        background: linear-gradient(180deg, rgba(0, 0, 0, .06) 0, transparent 12px);
        border-bottom: 1px solid #e8e8e8
    }

    .card--nested:last-child {
        border-bottom: 0
    }

    .card__header {
        padding-bottom: 24px
    }

    .card__title {
        font-size: 26px;
        line-height: 36px;
        margin: 12px 0
    }

    .card__corner {
        position: absolute;
        top: 36px;
        right: 36px
    }

    .card__content {
        padding: 24px 0
    }

    .card__split {
        width: 50%;
        float: left;
        padding-right: 18px
    }

    .list--bordered > * {
        padding: 12px 0;
        border-bottom: 1px solid #d4d5d5
    }

    .list--inline:after {
        content: "";
        display: block;
        clear: both
    }

    .list--inline > * {
        float: left;
        margin-right: 12px
    }

    .list--commaseparated > * {
        display: inline
    }

    .list--commaseparated > :after {
        content: ','
    }

    .list--commaseparated > :last-child:after {
        content: ''
    }

    .scoregraph {
        display: block;
        height: 48px;
        max-width: 460px;
        position: relative;
        background: #bdbdbd;
        border-radius: 1000px;
        overflow: hidden
    }

    .scoregraph__fill {
        position: absolute;
        top: 0;
        left: 0;
        width: auto;
        height: 100%;
        min-width: 20%;
        border-radius: 1000px;
        background: linear-gradient(to right top, #0075bc, #004d7d)
    }

    .scoregraph__fill--wr {
        background: linear-gradient(to right top, #e7b400, #c29800)
    }

    .scoregraph__result,
    .scoregraph__title {
        display: inline-block;
        position: absolute;
        top: 0;
        font-size: 14px;
        line-height: 24px;
        color: #fff;
        text-transform: uppercase;
        letter-spacing: .15em;
        line-height: 48px;
        text-shadow: 0 0 6px #000
    }

    .scoregraph__title {
        left: 18px;
        font-weight: 700
    }

    .scoregraph__result {
        right: 18px
    }

    .scoregraph__result__unit {
        text-transform: lowercase
    }

    .scoregraph--rotated {
        position: absolute;
        width: 100%;
        top: 0;
        left: 48px;
        transform: rotate(90deg);
        transform-origin: 0 0
    }

    .scoregraph--rotated:nth-child(2) {
        left: 144px
    }

    .scoregraph--rotated:nth-child(3) {
        left: 240px
    }

    .scoregraph--rotated:nth-child(4) {
        left: 336px
    }

    .site-header {
        position: relative;
        overflow: hidden;
        padding-top: 54px
    }

    @media(min-width:48em) {
        .site-header--default {
            background: url(../images/covers/aida-cover-default.jpg) no-repeat
        }
    }

    @media(min-width:48em) {
        .site-header--about {
            background: url(../images/covers/aida-cover-about.jpg) no-repeat
        }
    }

    @media(min-width:48em) {
        .site-header--athletes {
            background: url(../images/covers/aida-cover-athletes.jpg) no-repeat
        }
    }

    @media(min-width:48em) {
        .site-header--calendar {
            background: url(../images/covers/aida-cover-calendar.jpg) no-repeat
        }
    }

    @media(min-width:48em) {
        .site-header--news {
            background: url(../images/covers/aida-cover-news.jpg) no-repeat
        }
    }

    @media(min-width:48em) {
        .site-header--rankings {
            background: url(../images/covers/aida-cover-rankings.jpg) no-repeat
        }
    }

    @media(max-width:47.9375em) {
        .site-header {
            background: url(../images/header-smallbg.jpg) no-repeat;
            max-height: 260px
        }
    }

    @media(min-width:48em) {
        .site-header {
            background-position: center center;
            min-height: 660px;
            -webkit-mask-image: url(../images/covermask.png);
            mask-image: url(../images/covermask.png);
            -webkit-mask-position: center center;
            mask-position: center center;
            -webkit-mask-repeat: no-repeat;
            mask-repeat: no-repeat
        }
    }

    .site-header__pre {
        position: absolute;
        top: 0;
        width: 100%;
        padding: 12px 0;
        background: rgba(0, 0, 0, .4)
    }

    .site-header__content {
        position: relative
    }

    .site-header__branding {
        position: absolute;
        z-index: 1;
        top: 24px;
        left: 50%;
        transform: translateX(-50%)
    }

    .site-header__branding img {
        min-width: 120px
    }

    @media(min-width:48em) {
        .site-header__branding img {
            min-width: 172px
        }
    }

    .site-header__copy {
        padding: 180px 0 72px;
        text-align: center
    }

    @media(min-width:48em) {
        .site-header__copy {
            padding-top: 252px
        }
    }

    .site-header__title {
        position: absolute;
        bottom: 72px;
        width: 100%;
        text-align: center;
        font-size: 18px;
        line-height: 24px;
        color: #fff
    }

    @media(min-width:48em) {
        .site-header__title {
            top: 168px;
            bottom: auto
        }
    }

    @media(min-width:75em) {
        .site-header__title {
            width: auto;
            top: 24px;
            left: 0;
            text-align: left
        }
    }

    .site-header__claim {
        display: none;
        margin-bottom: 12px;
        font-size: 42px;
        line-height: 42px;
        font-weight: 700;
        text-transform: uppercase;
        color: #fff
    }

    @media(min-width:48em) {
        .site-header__claim {
            display: block;
            font-size: 66px;
            line-height: 72px
        }
    }

    @media(min-width:62em) {
        .site-header__claim {
            max-width: 560px;
            margin: 0 auto
        }
    }

    @media(min-width:75em) {
        .site-header__claim {
            max-width: 100%
        }
    }

    .site-header__subtitle {
        display: none;
        font-size: 26px;
        line-height: 24px;
        color: #fff
    }

    @media(min-width:48em) {
        .site-header__subtitle {
            display: block
        }
    }

    @media(max-width:74.9375em) {
        .site-header__sidenav {
            position: fixed;
            z-index: 2;
            top: 0;
            left: 0;
            width: 100%;
            height: 100%;
            overflow-y: auto;
            padding: 60px 24px 48px 96px;
            background: rgba(33, 33, 37, .95);
            opacity: 0;
            visibility: hidden;
            transition: all .2s ease-in-out
        }
        .site-header__sidenav .site-nav--primary {
            transition: all .2s ease-in-out;
            transform: translateY(-48px)
        }
        .site-header__sidenav.is-open {
            visibility: visible;
            opacity: 1
        }
        .site-header__sidenav.is-open .site-nav--primary {
            transform: translateY(0)
        }
    }

    @media(min-width:75em) {
        .site-header__sidenav {
            position: absolute;
            top: 120px;
            left: 0
        }
    }

    .site-header__topnav {
        display: none;
        position: absolute;
        top: 24px;
        right: 0
    }

    @media(min-width:75em) {
        .site-header__topnav {
            display: block
        }
    }

    .site-header__mobilenav {
        display: block;
        position: absolute;
        z-index: 2;
        top: 24px;
        left: 0
    }

    @media(min-width:48em) {
        .site-header__mobilenav {
            left: -12px
        }
    }

    @media(min-width:75em) {
        .site-header__mobilenav {
            display: none
        }
    }

    .site-nav--primary__item a {
        position: relative;
        display: block;
        padding: 18px 0;
        color: #fff;
        font-size: 26px;
        line-height: 36px;
        text-transform: uppercase;
        font-weight: 700
    }

    @media(max-width:74.9375em) {
        .site-nav--primary__item a {
            border-bottom: 2px solid hsla(0, 0%, 100%, .2)
        }
    }

    @media(min-width:48em) {
        .site-nav--primary__item a {
            font-size: 16px;
            line-height: 24px;
            padding: 12px 0
        }
    }

    @media(min-width:75em) {
        .site-nav--primary__item a {
            padding: 3px 0;
            transition: all .2s ease-in-out
        }
        .site-nav--primary__item a:before {
            content: '';
            display: none;
            position: absolute;
            top: 13.5px;
            left: -72px;
            width: 60px;
            height: 2px;
            background: #0075bc
        }
    }

    .site-nav--primary__item a:focus,
    .site-nav--primary__item a:hover {
        color: hsla(0, 0%, 100%, .6)
    }

    .site-nav--primary__item.is-active a {
        color: #0075bc
    }

    .site-nav--primary__item.is-active a:before {
        display: block
    }

    .site-nav--secondary__item {
        position: relative;
        float: left
    }

    .site-nav--secondary__item:hover .site-nav--secondary__subnav {
        transform: translateY(0);
        opacity: 1;
        visibility: visible
    }

    .site-nav--secondary__item > a {
        position: relative;
        display: block;
        padding: 3px 0;
        margin-right: 18px;
        color: #fff;
        transition: all .2s ease-in-out;
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        font-weight: 700
    }

    .site-nav--secondary__item > a:before {
        content: '';
        display: none;
        position: absolute;
        top: 30px;
        left: 0;
        width: 100%;
        height: 2px;
        background: #0075bc
    }

    .site-nav--secondary__item > a:focus,
    .site-nav--secondary__item > a:hover {
        color: hsla(0, 0%, 100%, .6)
    }

    .site-nav--secondary__item.is-active > a {
        color: #0075bc
    }

    .site-nav--secondary__item.is-active > a:before {
        display: block
    }

    .site-nav--secondary__droptitle {
        padding: 3px 0;
        margin-right: 18px;
        color: #fff;
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        font-weight: 700;
        cursor: default
    }

    .site-nav--secondary__subnav {
        position: absolute;
        top: 100%;
        left: 0;
        width: 180px;
        opacity: 0;
        transform: translateY(-18px);
        visibility: hidden;
        transition: all .2s ease-in
    }

    .site-nav--secondary__subnav__item > a {
        display: block;
        padding: 6px 0;
        color: #fff;
        transition: all .2s ease-in-out;
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        font-weight: 700
    }

    .site-nav--secondary__subnav__item > a:focus,
    .site-nav--secondary__subnav__item > a:hover {
        color: hsla(0, 0%, 100%, .6)
    }

    .site-nav--secondary__subnav__item.is-active > a {
        color: #0075bc
    }

    .site-nav--secondary__subnav__item:first-child a {
        padding-top: 12px
    }

    .site-title--ultra {
        padding-top: 24px;
        margin-bottom: 6px;
        font-size: 42px;
        line-height: 42px;
        font-family: futura-pt-condensed, Helvetica, Arial, sans-serif;
        font-weight: 500;
        text-transform: uppercase;
        background-size: 170px;
        background-repeat: no-repeat;
        background-position: center top
    }

    @media(min-width:48em) {
        .site-title--ultra {
            font-size: 66px;
            line-height: 60px
        }
    }

    .site-title--ultra--primary {
        background-image: url(../images/swoosh-positive.svg);
        color: #0075bc
    }

    .site-title--ultra--negative {
        background-image: url(../images/swoosh-negative.svg);
        color: #fff
    }

    .site-title--basic {
        font-size: 26px;
        line-height: 30px;
        font-weight: 700;
        text-transform: uppercase;
        color: #fff
    }

    @media(min-width:48em) {
        .site-title--basic {
            font-size: 34px;
            line-height: 36px
        }
    }

    .site-title--basic--primary {
        color: #0075bc
    }

    .site-title--basic--negative {
        color: #fff
    }

    .site-worldrecords__toggletitle.is-active {
        font-weight: 700
    }

    .site-worldrecords__records {
        overflow: hidden
    }

    .site-worldrecords__record {
        overflow: hidden;
        margin-bottom: 60px
    }

    @media(min-width:48em) {
        .site-worldrecords__record {
            width: calc(99.99%*1/2 - 15px)
        }
        .site-worldrecords__record:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-worldrecords__record:last-child {
            margin-right: 0
        }
        .site-worldrecords__record:nth-child(2n) {
            margin-right: 0;
            float: right
        }
        .site-worldrecords__record:nth-child(odd) {
            clear: left
        }
    }

    @media(min-width:75em) {
        .site-worldrecords__record {
            width: calc(99.99%*1/4 - 22.5px)
        }
        .site-worldrecords__record:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-worldrecords__record:last-child {
            margin-right: 0
        }
        .site-worldrecords__record:nth-child(4n) {
            margin-right: 0;
            float: right
        }
        .site-worldrecords__record:nth-child(4n+1) {
            clear: left
        }
    }

    .site-worldrecords__title {
        padding-bottom: 12px;
        margin-bottom: 12px;
        font-size: 18px;
        line-height: 30px;
        border-bottom: 1px solid rgba(33, 33, 37, .2)
    }

    @media(min-width:48em) {
        .site-worldrecords__title {
            text-align: center
        }
    }

    .site-worldrecords__photo {
        float: left;
        width: 40%;
        padding: 12px 30px 0 0
    }

    .site-worldrecords__photo__wrapper {
        position: static;
        -webkit-mask-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAABCAIAAACQd1PeAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAA5JREFUeNpiYGBgAAgwAAAEAAGbA+oJAAAAAElFTkSuQmCC);
        mask-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAABCAIAAACQd1PeAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAA5JREFUeNpiYGBgAAgwAAAEAAGbA+oJAAAAAElFTkSuQmCC);
        width: 72px;
        height: 72px;
        border-radius: 50%;
        overflow: hidden
    }

    @media(min-width:34em) {
        .site-worldrecords__photo {
            width: 30%
        }
    }

    .site-worldrecords__content {
        width: 60%;
        padding-top: 12px;
        overflow: hidden
    }

    @media(min-width:34em) {
        .site-worldrecords__content {
            width: 70%
        }
    }

    .site-worldrecords__name {
        display: block;
        font-weight: 700
    }

    .site-worldrecords__name span {
        font-weight: 400
    }

    .site-worldrecords__recordvalue {
        font-size: 26px;
        line-height: 30px;
        font-weight: 700;
        color: #212125
    }

    .site-athleteswidget {
        overflow: hidden;
        padding: 0 36px 36px
    }

    @media(min-width:62em) {
        .site-athleteswidget {
            padding: 0 72px 72px
        }
    }

    @media(max-width:61.9375em) {
        .site-athleteswidget__athlete--multiple {
            margin-bottom: 48px
        }
    }

    @media(min-width:62em) {
        .site-athleteswidget__athlete--multiple {
            width: calc(99.99%*1/3 - 20px)
        }
        .site-athleteswidget__athlete--multiple:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athleteswidget__athlete--multiple:last-child {
            margin-right: 0
        }
        .site-athleteswidget__athlete--multiple:nth-child(3n) {
            margin-right: 0;
            float: right
        }
        .site-athleteswidget__athlete--multiple:nth-child(3n+1) {
            clear: left
        }
    }

    .site-athleteswidget__photo {
        margin-bottom: 24px;
        text-align: center
    }

    .site-athleteswidget__photo img {
        border: 9px solid #0075bc;
        position: static;
        -webkit-mask-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAABCAIAAACQd1PeAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAA5JREFUeNpiYGBgAAgwAAAEAAGbA+oJAAAAAElFTkSuQmCC);
        mask-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAABCAIAAACQd1PeAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAA5JREFUeNpiYGBgAAgwAAAEAAGbA+oJAAAAAElFTkSuQmCC);
        width: 170px;
        height: 170px;
        border-radius: 50%;
        overflow: hidden
    }

    .site-athleteswidget__photo--negative img {
        border-color: #fff
    }

    .site-athleteswidget__info--negative {
        color: #fff
    }

    .site-athleteswidget__name {
        font-size: 26px;
        line-height: 24px;
        margin-bottom: 12px;
        text-align: center
    }

    .site-athleteswidget__name span {
        text-transform: uppercase
    }

    .site-athleteswidget__medals {
        margin-bottom: 12px;
        text-align: center
    }

    .site-athleteswidget__medals img {
        width: 24px
    }

    .site-athleteswidget__subtitle {
        text-align: center;
        margin-bottom: 12px
    }

    .site-athleteswidget__stats {
        border-top: 1px solid #0075bc;
        padding-top: 12px;
        overflow: hidden
    }

    .site-athleteswidget__stats--negative {
        border-color: #fff
    }

    .site-athleteswidget__stats__col {
        width: calc(99.99%*1/4 - 22.5px);
        margin-bottom: 24px;
        font-size: 16px;
        line-height: 24px
    }

    .site-athleteswidget__stats__col:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .site-athleteswidget__stats__col:last-child {
        margin-right: 0
    }

    .site-athleteswidget__stats__col:nth-child(4n) {
        margin-right: 0;
        float: right
    }

    .site-athleteswidget__stats__col:nth-child(4n+1) {
        clear: left
    }

    @media(min-width:34em) {
        .site-athleteswidget__stats__col {
            width: calc(99.99%*1/7 - 25.714285714285715px)
        }
        .site-athleteswidget__stats__col:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athleteswidget__stats__col:last-child {
            margin-right: 0
        }
        .site-athleteswidget__stats__col:nth-child(7n) {
            margin-right: 0;
            float: right
        }
        .site-athleteswidget__stats__col:nth-child(7n+1) {
            clear: left
        }
    }

    @media(min-width:48em) {
        .site-athleteswidget__stats__col {
            width: calc(99.99%*1/4 - 22.5px)
        }
        .site-athleteswidget__stats__col:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athleteswidget__stats__col:last-child {
            margin-right: 0
        }
        .site-athleteswidget__stats__col:nth-child(4n) {
            margin-right: 0;
            float: right
        }
        .site-athleteswidget__stats__col:nth-child(4n+1) {
            clear: left
        }
    }

    @media(min-width:75em) {
        .site-athleteswidget__stats__col {
            width: calc(99.99%*1/7 - 25.714285714285715px);
            margin-bottom: 0
        }
        .site-athleteswidget__stats__col:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athleteswidget__stats__col:last-child {
            margin-right: 0
        }
        .site-athleteswidget__stats__col:nth-child(7n) {
            margin-right: 0;
            float: right
        }
        .site-athleteswidget__stats__col:nth-child(7n+1) {
            clear: left
        }
    }

    .site-rankingwidget {
        padding: 0 36px 36px
    }

    @media(min-width:62em) {
        .site-rankingwidget {
            padding: 0 72px 72px
        }
    }

    .site-rankingwidget__discipline {
        font-size: 16px;
        line-height: 24px;
        color: #fff
    }

    .site-rankingwidget__discipline:focus,
    .site-rankingwidget__discipline:hover {
        color: hsla(0, 0%, 100%, .6)
    }

    .site-rankingwidget__discipline:active {
        color: #fff
    }

    .site-rankingwidget__discipline.is-active {
        font-weight: 700
    }

    .site-rankingwidget__table {
        width: 100%;
        color: #fff
    }

    .site-rankingwidget__table tr {
        border-bottom: 1px solid #fff
    }

    .site-rankingwidget__table td,
    .site-rankingwidget__table th {
        padding: 6px
    }

    .site-rankingwidget__table td,
    .site-rankingwidget__table th {
        font-size: 16px;
        line-height: 24px
    }

    @media(min-width:62em) {
        .site-athletedetails__profile {
            width: calc(99.99%*1/3 - 20px)
        }
        .site-athletedetails__profile:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athletedetails__profile:last-child {
            margin-right: 0
        }
        .site-athletedetails__profile:nth-child(3n) {
            margin-right: 0;
            float: right
        }
        .site-athletedetails__profile:nth-child(3n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .site-athletedetails__results {
            width: calc(99.99%*1/3 - 20px)
        }
        .site-athletedetails__results:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athletedetails__results:last-child {
            margin-right: 0
        }
        .site-athletedetails__results:nth-child(3n) {
            margin-right: 0;
            float: right
        }
        .site-athletedetails__results:nth-child(3n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .site-athletedetails__recent {
            width: calc(99.99%*1/3 - 20px)
        }
        .site-athletedetails__recent:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athletedetails__recent:last-child {
            margin-right: 0
        }
        .site-athletedetails__recent:nth-child(3n) {
            margin-right: 0;
            float: right
        }
        .site-athletedetails__recent:nth-child(3n+1) {
            clear: left
        }
    }

    .site-athletedetails__recent__item {
        overflow: hidden;
        padding: 12px 0;
        border-bottom: 1px solid #dedede
    }

    .site-athletedetails__recent__date {
        width: 20%;
        float: left
    }

    .site-athletedetails__recent__title {
        width: 80%;
        float: left
    }

    .site-athletedetails__graphs {
        padding-top: 48px
    }

    @media(min-width:62em) {
        .site-athletedetails__graphs {
            width: calc(99.99%*2/3 - 10px);
            position: relative;
            left: calc(99.99%*1/3 - 20px + 30px)
        }
        .site-athletedetails__graphs:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athletedetails__graphs:last-child {
            margin-right: 0
        }
        .site-athletedetails__graphs:nth-child(3n) {
            margin-right: 0;
            float: right
        }
        .site-athletedetails__graphs:nth-child(3n+1) {
            clear: left
        }
    }

    .site-athletedetails__graphs__grid {
        min-height: 720px
    }

    .site-athletedetails__graphs__grid:after {
        content: "";
        display: block;
        clear: both
    }

    @media(min-width:48em) {
        .site-athletedetails__graphs__grid {
            min-height: 474px
        }
    }

    .site-athletedetails__graphs__grid__item {
        position: relative
    }

    @media(min-width:48em) {
        .site-athletedetails__graphs__grid__item {
            width: calc(99.99%*1/2 - 15px)
        }
        .site-athletedetails__graphs__grid__item:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-athletedetails__graphs__grid__item:last-child {
            margin-right: 0
        }
        .site-athletedetails__graphs__grid__item:nth-child(2n) {
            margin-right: 0;
            float: right
        }
        .site-athletedetails__graphs__grid__item:nth-child(odd) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .site-eventswidget {
            display: flex;
            flex-flow: row wrap
        }
    }

    .site-eventswidget__event {
        position: relative;
        margin-bottom: 24px;
        background: #fff
    }

    @media(min-width:62em) {
        .site-eventswidget__event {
            flex: 0 0 auto;
            width: calc(99.99%*1/3 - 20px)
        }
        .site-eventswidget__event:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .site-eventswidget__event:last-child {
            margin-right: 0
        }
        .site-eventswidget__event:nth-child(3n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:90em) {
        .site-eventswidget__event {
            flex: 0 0 auto;
            width: calc(99.99%*1/6 - 25px)
        }
        .site-eventswidget__event:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .site-eventswidget__event:last-child {
            margin-right: 0
        }
        .site-eventswidget__event:nth-child(6n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    .site-eventswidget__content {
        padding: 24px 24px 72px
    }

    .site-eventswidget__title {
        font-size: 18px;
        line-height: 24px;
        font-weight: 700
    }

    .site-eventswidget__type {
        position: absolute;
        width: 100%;
        bottom: 0;
        left: 0;
        padding: 12px 24px;
        font-size: 16px;
        line-height: 18px;
        text-transform: uppercase;
        text-align: center;
        color: #fff
    }

    .site-eventswidget__type--competition {
        background: #0075bc
    }

    .site-eventswidget__type--competition-depth {
        background: #004c7b
    }

    .site-eventswidget__type--competition-pool {
        background: #75c4f4
    }

    .site-eventswidget__type--competition-mixed {
        background: #54e3b3
    }

    .site-eventswidget__type--competition-team {
        background: #7c51ee
    }

    .site-eventswidget__type--competition-wra {
        background: #eec951
    }

    .site-eventswidget__type--competition-wc {
        background: #ee5171
    }

    .site-eventswidget__type--freedivingcourse {
        background: #8cc640
    }

    .site-eventswidget__type--instructorcourse {
        background: #f79321
    }

    .site-eventswidget__type--judgecourse {
        background: #ff0
    }

    .site-aboutwidget {
        overflow: hidden
    }

    .site-aboutwidget__about,
    .site-aboutwidget__newsletter {
        margin: 36px 0;
        padding: 0 36px
    }

    @media(min-width:48em) {
        .site-aboutwidget__about,
        .site-aboutwidget__newsletter {
            float: left;
            width: 50%;
            margin: 72px 0;
            padding: 0 72px
        }
    }

    @media(max-width:47.9375em) {
        .site-aboutwidget__about {
            border-bottom: 1px solid hsla(0, 0%, 100%, .4)
        }
    }

    .site-contentpage {
        padding: 24px 0;
        max-width: 800px;
        margin: 0 auto
    }

    @media(min-width:48em) {
        .site-contentpage {
            padding: 0 0 72px
        }
    }

    @media(max-width:47.9375em) {
        .site-ranking {
            margin-bottom: 24px
        }
    }

    @media(min-width:48em) {
        .site-ranking__filter {
            width: calc(99.99%*1/5 - 24px)
        }
        .site-ranking__filter:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-ranking__filter:last-child {
            margin-right: 0
        }
        .site-ranking__filter:nth-child(5n) {
            margin-right: 0;
            float: right
        }
        .site-ranking__filter:nth-child(5n+1) {
            clear: left
        }
    }

    .site-news__article {
        margin-bottom: 60px
    }

    .site-news__title {
        font-size: 26px;
        line-height: 30px;
        margin-bottom: 12px;
        color: #212125
    }

    @media(min-width:48em) {
        .site-news__title {
            font-size: 34px;
            line-height: 36px
        }
    }

    .site-news__meta {
        font-size: 16px;
        line-height: 24px
    }

    .site-news__header,
    .site-news__visual {
        margin-bottom: 24px
    }

    .site-news__content {
        margin-bottom: 12px
    }

    .site-news__content p {
        font-size: 18px;
        line-height: 30px
    }

    @media(max-width:47.9375em) {
        .site-news__content img {
            width: 100%
        }
    }

    @media(min-width:62em) {
        .site-listing--judges__nav {
            width: calc(99.99%*3/12 - 22.5px)
        }
        .site-listing--judges__nav:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-listing--judges__nav:last-child {
            margin-right: 0
        }
        .site-listing--judges__nav:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-listing--judges__nav:nth-child(12n+1) {
            clear: left
        }
    }

    @media(max-width:61.9375em) {
        .site-listing--judges__items {
            padding-top: 48px
        }
    }

    @media(min-width:62em) {
        .site-listing--judges__items {
            width: calc(99.99%*9/12 - 7.5px)
        }
        .site-listing--judges__items:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-listing--judges__items:last-child {
            margin-right: 0
        }
        .site-listing--judges__items:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-listing--judges__items:nth-child(12n+1) {
            clear: left
        }
    }

    @media(min-width:34em) {
        .site-listing--judges__group {
            display: -ms-flexbox;
            display: flex;
            -ms-flex-wrap: wrap;
            flex-wrap: wrap
        }
    }

    .site-listing--judges__item {
        margin-bottom: 48px
    }

    @media(min-width:34em) {
        .site-listing--judges__item {
            width: 50%
        }
    }

    @media(min-width:48em) {
        .site-listing--judges__item {
            text-align: left;
            width: 25%;
            padding-right: 12px
        }
    }

    @media(min-width:48em) {
        .site-listing--board {
            display: flex;
            flex-flow: row wrap
        }
    }

    .site-listing--board__item {
        margin-bottom: 48px
    }

    @media(min-width:48em) {
        .site-listing--board__item {
            flex: 0 0 auto;
            width: calc(99.99%*4/12 - 20px)
        }
        .site-listing--board__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .site-listing--board__item:last-child {
            margin-right: 0
        }
        .site-listing--board__item:nth-child(3n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:75em) {
        .site-listing--board__item {
            margin-bottom: 96px;
            flex: 0 0 auto;
            width: calc(99.99%*3/12 - 22.5px)
        }
        .site-listing--board__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .site-listing--board__item:last-child {
            margin-right: 0
        }
        .site-listing--board__item:nth-child(4n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:48em) {
        .site-listing--assembly {
            display: flex;
            flex-flow: row wrap
        }
    }

    .site-listing--assembly__item {
        margin-bottom: 36px
    }

    .site-listing--assembly__item__logo {
        margin-bottom: 24px
    }

    .site-listing--assembly__item__logo img {
        width: auto;
        height: 60px
    }

    @media(min-width:48em) {
        .site-listing--assembly__item {
            flex: 0 0 auto;
            width: calc(99.99%*6/12 - 15px);
            margin-bottom: 72px
        }
        .site-listing--assembly__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .site-listing--assembly__item:last-child {
            margin-right: 0
        }
        .site-listing--assembly__item:nth-child(2n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:62em) {
        .site-listing--assembly__item {
            flex: 0 0 auto;
            width: calc(99.99%*4/12 - 20px)
        }
        .site-listing--assembly__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .site-listing--assembly__item:last-child {
            margin-right: 0
        }
        .site-listing--assembly__item:nth-child(3n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    .site-judgeprofile {
        overflow: hidden
    }

    @media(min-width:62em) {
        .site-judgeprofile__overview {
            width: calc(99.99%*6/12 - 15px)
        }
        .site-judgeprofile__overview:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-judgeprofile__overview:last-child {
            margin-right: 0
        }
        .site-judgeprofile__overview:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-judgeprofile__overview:nth-child(12n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .site-judgeprofile__basicinfo {
            width: calc(80.99%*6/12 - 15px)
        }
        .site-judgeprofile__basicinfo:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-judgeprofile__basicinfo:last-child {
            margin-right: 0
        }
        .site-judgeprofile__basicinfo:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-judgeprofile__basicinfo:nth-child(12n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .site-judgeprofile__history {
            width: calc(99.99%*6/12 - 15px)
        }
        .site-judgeprofile__history:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-judgeprofile__history:last-child {
            margin-right: 0
        }
        .site-judgeprofile__history:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-judgeprofile__history:nth-child(12n+1) {
            clear: left
        }
    }

    .site-judgecard__wrapper {
        display: block
    }

    @media(min-width:62em) {
        .site-judgecard__wrapper {
            width: calc(99.99%*6/12 - 15px)
        }
        .site-judgecard__wrapper:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-judgecard__wrapper:last-child {
            margin-right: 0
        }
        .site-judgecard__wrapper:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-judgecard__wrapper:nth-child(12n+1) {
            clear: left
        }
    }

    .site-judgecard__back {
        position: relative;
        z-index: 2;
        display: table;
        width: 520px;
        height: 290px;
        border-radius: 6px;
        clear: both;
        overflow: hidden
    }

    .site-judgecard__back:before {
        position: absolute;
        content: "";
        top: 0;
        right: 0;
        bottom: 0;
        left: 0;
        z-index: -2;
        background: url(../images/card-background-blue.png);
        background-size: cover
    }

    .site-judgecard__back:after {
        position: absolute;
        content: "";
        top: 50%;
        right: 0;
        bottom: 0;
        left: -30%;
        width: 200%;
        height: 100%;
        border-radius: 50%;
        z-index: -1
    }

    .site-judgecard__avatar {
        display: table-cell;
        width: 40%;
        height: auto;
        padding-top: 42px;
        float: left;
        border-radius: 4px;
        text-align: center
    }

    .site-judgecard__avatar img {
        width: 140px;
        height: auto;
        border-radius: 10%
    }

    .site-judgecard__info {
        display: table-cell;
        width: 60%;
        height: auto;
        padding-top: 21px;
        float: right;
        color: #fff
    }

    .site-judgecard__info img {
        width: 140px;
        height: auto;
        margin-bottom: 60px
    }

    .site-judgecard__content {
        padding-left: 50px
    }

    .site-judgecard__info--center {
        display: block;
        height: auto;
        padding-top: 42px;
        text-align: center
    }

    .site-judgecard__info--center img {
        width: 190px;
        height: auto;
        margin-bottom: 6px
    }

    .site-judgecard__front {
        position: relative;
        z-index: 2;
        display: table;
        width: 520px;
        height: 290px;
        border-radius: 6px;
        background: radial-gradient(ellipse at center, #ffed00 0, #fc0 83%);
        clear: both;
        overflow: hidden
    }

    .site-judgecard__front:before {
        position: absolute;
        content: "";
        top: 0;
        right: 0;
        bottom: 0;
        left: 0;
        z-index: -2;
        background-size: cover
    }

    @media(min-width:48em) {
        .site-eventcalendar__filter {
            width: calc(99.99%*4/12 - 20px)
        }
        .site-eventcalendar__filter:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .site-eventcalendar__filter:last-child {
            margin-right: 0
        }
        .site-eventcalendar__filter:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .site-eventcalendar__filter:nth-child(12n+1) {
            clear: left
        }
    }

    .auth__header {
        padding: 48px;
        border-bottom: 1px solid #e8e8e8;
        background: #fff
    }

    .auth__title {
        font-size: 26px;
        line-height: 36px;
        font-weight: 700;
        text-transform: uppercase;
        letter-spacing: .1em
    }

    .auth__content {
        padding: 48px;
        background: #fff
    }

    .auth__footer {
        padding: 24px 48px;
        border-top: 1px solid #e8e8e8;
        background: #fff
    }

    .auth__splitform {
        overflow: hidden
    }

    .auth__splitform__item {
        width: calc(99.99%*1/2 - 15px)
    }

    .auth__splitform__item:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .auth__splitform__item:last-child {
        margin-right: 0
    }

    .auth__splitform__item:nth-child(2n) {
        margin-right: 0;
        float: right
    }

    .auth__splitform__item:nth-child(odd) {
        clear: left
    }

    .header {
        overflow: hidden;
        padding: 24px;
        background: #fff
    }

    .header__heading {
        width: 60%;
        float: left
    }

    .header__action {
        width: 40%;
        float: right
    }

    .header__title {
        font-size: 18px;
        line-height: 24px;
        font-weight: 700;
        text-transform: uppercase;
        letter-spacing: .1em
    }

    .page__header {
        padding: 24px 36px;
        margin: -36px -36px 0;
        background: hsla(0, 0%, 100%, .4)
    }

    .page__subheader {
        margin: 0 -36px;
        padding: 24px 36px
    }

    .page__content {
        padding: 24px 0
    }

    .page__footer {
        padding: 24px 36px;
        margin: 0 -36px -36px;
        border-top: 1px solid #d4d5d5
    }

    .nav__branding {
        max-width: 140px;
        margin: 24px auto 48px
    }

    .nav__heading {
        margin-top: 24px;
        padding: 24px
    }

    .nav__title {
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        letter-spacing: .15em;
        color: hsla(0, 0%, 100%, .7)
    }

    .nav__item {
        overflow: hidden
    }

    .nav__item.is-active a {
        background: hsla(0, 0%, 100%, .1);
        color: #fff
    }

    .nav__item.is-active a > i {
        color: #fff
    }

    .nav__link {
        position: relative;
        display: block;
        padding: 18px 24px 18px 66px;
        color: #fff;
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        letter-spacing: .1em;
        font-weight: 700
    }

    .nav__link,
    .nav__link > i {
        transition: all .2s ease-in
    }

    .nav__link > i {
        position: absolute;
        top: 12px;
        left: 24px;
        font-size: 34px;
        color: hsla(0, 0%, 100%, .4)
    }

    .nav__link:focus,
    .nav__link:hover {
        background: hsla(0, 0%, 100%, .1);
        color: #fff
    }

    .nav__link:focus > i,
    .nav__link:hover > i {
        color: hsla(0, 0%, 100%, .7)
    }

    .nav__subnav__item {
        color: #fff
    }

    .nav__subnav__item.is-active a {
        background: hsla(0, 0%, 100%, .1);
        color: #fff
    }

    .nav__subnav__link {
        position: relative;
        display: block;
        padding: 12px 24px 12px 60px;
        color: #fff;
        transition: all .2s ease-in
    }

    .nav__subnav__link:focus,
    .nav__subnav__link:hover {
        background: hsla(0, 0%, 100%, .1);
        color: #fff
    }

    .sidenav__title {
        margin: 12px 0
    }

    .sidenav__link,
    .sidenav__title {
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        letter-spacing: .15em
    }

    .sidenav__link {
        display: block;
        padding: 12px;
        color: #505c69;
        border-bottom: 1px solid #e8e8e8;
        background: #fff
    }

    .sidenav__link:focus,
    .sidenav__link:hover {
        background: hsla(0, 0%, 100%, .7)
    }

    .sidenav__link.is-active,
    .sidenav__link.is-active:focus,
    .sidenav__link.is-active:hover {
        background: #0075bc;
        color: #fff
    }

    .footer {
        overflow: hidden;
        padding: 36px 0;
        background: #212125
    }

    .footer__pages {
        overflow: hidden;
        margin-bottom: 48px
    }

    @media(min-width:48em) {
        .footer__pages {
            float: left;
            width: 60%
        }
    }

    .footer__nav {
        width: calc(99.99%*1/2 - 15px)
    }

    .footer__nav:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .footer__nav:last-child {
        margin-right: 0
    }

    .footer__nav:nth-child(2n) {
        margin-right: 0;
        float: right
    }

    .footer__nav:nth-child(odd) {
        clear: left
    }

    @media(min-width:48em) {
        .footer__nav {
            width: calc(99.99%*1/4 - 22.5px)
        }
        .footer__nav:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .footer__nav:last-child {
            margin-right: 0
        }
        .footer__nav:nth-child(4n) {
            margin-right: 0;
            float: right
        }
        .footer__nav:nth-child(4n+1) {
            clear: left
        }
    }

    .footer__nav__item a {
        display: block;
        padding: 9px 0;
        font-size: 14px;
        line-height: 18px;
        text-transform: uppercase;
        font-weight: 700;
        color: rgba(0, 117, 188, .8)
    }

    .footer__nav__item a:focus,
    .footer__nav__item a:hover {
        color: rgba(0, 117, 188, .6)
    }

    @media(min-width:48em) {
        .footer__connect {
            float: right;
            width: 20%
        }
    }

    .footer__connect__title {
        font-size: 16px;
        line-height: 24px;
        font-weight: 700;
        text-transform: uppercase;
        color: #0075bc
    }

    .item {
        display: -ms-flexbox;
        display: flex;
        background: #fff;
        min-height: 72px
    }

    .item__heading {
        flex: 0 0 auto;
        width: calc(99.99%*3/12 - 22.5px);
        padding: 18px 24px
    }

    .item__heading:nth-child(1n) {
        margin-right: 30px;
        margin-left: 0
    }

    .item__heading:last-child {
        margin-right: 0
    }

    .item__heading:nth-child(12n) {
        margin-right: 0;
        margin-left: auto
    }

    .item__title {
        font-size: 18px;
        line-height: 24px;
        font-weight: 700
    }

    .item__content {
        flex: 0 0 auto;
        width: calc(99.99%*6/12 - 15px);
        padding: 18px 0
    }

    .item__content:nth-child(1n) {
        margin-right: 30px;
        margin-left: 0
    }

    .item__content:last-child {
        margin-right: 0
    }

    .item__content:nth-child(12n) {
        margin-right: 0;
        margin-left: auto
    }

    .item__options {
        flex: 0 0 auto;
        width: calc(99.99%*3/12 - 22.5px);
        padding: 18px 12px 0 30px
    }

    .item__options:nth-child(1n) {
        margin-right: 30px;
        margin-left: 0
    }

    .item__options:last-child {
        margin-right: 0
    }

    .item__options:nth-child(12n) {
        margin-right: 0;
        margin-left: auto
    }

    .item__options:after {
        content: "";
        display: block;
        clear: both
    }

    .item--event__meta {
        width: calc(99.99%*1/2 - 15px)
    }

    .item--event__meta:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .item--event__meta:last-child {
        margin-right: 0
    }

    .item--event__meta:nth-child(2n) {
        margin-right: 0;
        float: right
    }

    .item--event__meta:nth-child(odd) {
        clear: left
    }

    .item-list--spaced .item {
        margin-bottom: 6px
    }

    .options:after {
        content: "";
        display: block;
        clear: both
    }

    .options__option {
        float: left;
        padding: 6px 12px;
        color: rgba(33, 33, 37, .6)
    }

    .options__option i {
        font-size: 24px
    }

    .eventbuilder__builder {
        overflow: hidden
    }

    .eventbuilder__disciplines__single {
        margin-bottom: 48px
    }

    .eventresults__results {
        overflow: hidden
    }

    .eventresults__athlete__single {
        overflow: hidden
    }

    .eventresults__athlete__single__content,
    .eventresults__athlete__single__profile {
        float: left
    }

    .azlist {
        position: relative;
        margin-bottom: 48px
    }

    .azlist__letters {
        overflow: hidden;
        overflow-x: auto
    }

    @media(min-width:62em) {
        .azlist__letters {
            position: absolute;
            top: 0;
            left: 50%;
            transform: translateX(-50%);
            min-width: 960px
        }
    }

    .azlist__letters__item {
        float: left
    }

    .azlist__letters__link {
        position: relative;
        display: block;
        padding: 6px 12px;
        font-size: 16px;
        line-height: 24px;
        text-transform: uppercase;
        letter-spacing: .1em;
        font-weight: 700;
        color: #505c69
    }

    .azlist__letters__link.is-active,
    .azlist__letters__link:focus,
    .azlist__letters__link:hover {
        background: #0075bc;
        color: #fff
    }

    .azlist__people {
        margin: 0 auto;
        padding-top: 72px
    }

    @media(min-width:34em) {
        .azlist__people {
            display: flex;
            flex-flow: row wrap
        }
    }

    @media(min-width:34em) {
        .azlist__people__item {
            flex: 0 0 auto;
            width: calc(99.99%*6/12 - 15px)
        }
        .azlist__people__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .azlist__people__item:last-child {
            margin-right: 0
        }
        .azlist__people__item:nth-child(2n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:48em) {
        .azlist__people__item {
            flex: 0 0 auto;
            width: calc(99.99%*4/12 - 20px)
        }
        .azlist__people__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .azlist__people__item:last-child {
            margin-right: 0
        }
        .azlist__people__item:nth-child(3n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:62em) {
        .azlist__people__item {
            flex: 0 0 auto;
            width: calc(99.99%*3/12 - 22.5px)
        }
        .azlist__people__item:nth-child(1n) {
            margin-right: 30px;
            margin-left: 0
        }
        .azlist__people__item:last-child {
            margin-right: 0
        }
        .azlist__people__item:nth-child(4n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    .azlist__people__link {
        display: block;
        padding: 12px 0
    }

    @media(min-width:62em) {
        .eventcalendar {
            width: 60%;
            margin: 0 auto
        }
    }

    .eventcalendar__daynames {
        overflow: hidden
    }

    .eventcalendar__day,
    .eventcalendar__dayname {
        background: #edeeef;
        vertical-align: top;
        font-size: 16px;
        line-height: 24px;
        border: 1px solid #fff
    }

    .eventcalendar__dayname {
        text-transform: uppercase;
        font-weight: 700
    }

    .eventcalendar__day,
    .eventcalendar__dayname {
        display: block;
        float: left;
        padding: 12px;
        width: 14.28571%
    }

    .eventcalendar__day.past {
        background-color: hsla(210, 6%, 93%, .7);
        color: rgba(80, 92, 105, .7)
    }

    .eventcalendar__day.today {
        font-weight: 700
    }

    .eventcalendar__day.event {
        font-weight: 700;
        background-color: #0075bc;
        color: #fff
    }

    .eventcalendar__day.is-active {
        background: #0075bc;
        color: #fff
    }

    .eventcalendar__events {
        margin-top: 1px;
        padding: 0 1px
    }

    .eventcalendar__events__single {
        overflow: hidden;
        padding: 24px 12px;
        margin-bottom: 2px;
        text-align: center;
        background: #edeeef
    }

    @media(min-width:62em) {
        .eventcalendar__events__single {
            padding: 12px;
            text-align: left
        }
    }

    .eventcalendar__events__single--header {
        display: none;
        font-weight: 700;
        color: #505c69;
        background-color: transparent
    }

    @media(min-width:62em) {
        .eventcalendar__events__single--header {
            display: block
        }
    }

    .eventcalendar__events__single--competition {
        border-left: 3px solid #0075bc
    }

    .eventcalendar__events__single--freedivingcourse {
        border-left: 3px solid #8cc640
    }

    .eventcalendar__events__single--instructorcourse {
        border-left: 3px solid #f79321
    }

    .eventcalendar__events__single--judgecourse {
        border-left: 3px solid #ff0
    }

    .eventcalendar__events__single--competition-depth {
        border-left: 3px solid #004c7b
    }

    .eventcalendar__events__single--competition-pool {
        border-left: 3px solid #75c4f4
    }

    .eventcalendar__events__single--competition-mixed {
        border-left: 3px solid #54e3b3
    }

    .eventcalendar__events__single--competition-team {
        border-left: 3px solid #7c51ee
    }

    .eventcalendar__events__single--competition-wra {
        border-left: 3px solid #eec951
    }

    .eventcalendar__events__single--competition-wc {
        border-left: 3px solid #ee5171
    }

    .eventcalendar__events__single__title {
        margin-bottom: 24px
    }

    @media(min-width:62em) {
        .eventcalendar__events__single__title {
            width: calc(99.99%*4/12 - 20px);
            margin-bottom: 0
        }
        .eventcalendar__events__single__title:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .eventcalendar__events__single__title:last-child {
            margin-right: 0
        }
        .eventcalendar__events__single__title:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .eventcalendar__events__single__title:nth-child(12n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .eventcalendar__events__single__city {
            width: calc(99.99%*3/12 - 22.5px)
        }
        .eventcalendar__events__single__city:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .eventcalendar__events__single__city:last-child {
            margin-right: 0
        }
        .eventcalendar__events__single__city:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .eventcalendar__events__single__city:nth-child(12n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .eventcalendar__events__single__country {
            width: calc(99.99%*3/12 - 22.5px)
        }
        .eventcalendar__events__single__country:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .eventcalendar__events__single__country:last-child {
            margin-right: 0
        }
        .eventcalendar__events__single__country:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .eventcalendar__events__single__country:nth-child(12n+1) {
            clear: left
        }
    }

    @media(min-width:62em) {
        .eventcalendar__events__single__link {
            width: calc(99.99%*2/12 - 25px)
        }
        .eventcalendar__events__single__link:nth-child(1n) {
            float: left;
            margin-right: 30px;
            clear: none
        }
        .eventcalendar__events__single__link:last-child {
            margin-right: 0
        }
        .eventcalendar__events__single__link:nth-child(12n) {
            margin-right: 0;
            float: right
        }
        .eventcalendar__events__single__link:nth-child(12n+1) {
            clear: left
        }
    }

    .terms {
        font-size: 16px;
        line-height: 18px;
        max-height: 240px;
        overflow-y: auto;
        padding: 12px;
        border: 1px solid #dedede
    }

    .site-homepage__section--alt {
        background: hsla(210, 6%, 93%, .4)
    }

    .site-homepage__section__header {
        padding: 36px 0;
        text-align: center
    }

    @media(min-width:48em) {
        .site-homepage__section__header {
            margin: 0 auto;
            padding: 72px 0;
            max-width: 600px
        }
    }

    .site-homepage__section__content {
        padding: 0 0 36px
    }

    .site-homepage__section__footer {
        padding: 36px 0;
        text-align: center
    }

    @media(min-width:48em) {
        .site-homepage__section__footer {
            padding: 72px 0
        }
    }

    .site-homepage__split {
        overflow: hidden
    }

    @media(min-width:48em) {
        .site-homepage__split {
            display: -ms-flexbox;
            display: flex
        }
    }

    @media(min-width:48em) {
        .site-homepage__split__item {
            flex: 0 0 auto;
            width: calc(99.99%*1/2 - 6px)
        }
        .site-homepage__split__item:nth-child(1n) {
            margin-right: 12px;
            margin-left: 0
        }
        .site-homepage__split__item:last-child {
            margin-right: 0
        }
        .site-homepage__split__item:nth-child(2n) {
            margin-right: 0;
            margin-left: auto
        }
    }

    @media(min-width:48em) {
        .site-homepage__pushup {
            position: relative;
            z-index: 1
        }
        .site-homepage__pushup:not(:root) {
            margin-top: -120px
        }
    }

    .u-grid:after {
        content: "";
        display: block;
        clear: both
    }

    .u-grid__col1 {
        width: calc(99.99%*1/12 - 27.5px)
    }

    .u-grid__col1:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col1:last-child {
        margin-right: 0
    }

    .u-grid__col1:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col1:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col2 {
        width: calc(99.99%*2/12 - 25px)
    }

    .u-grid__col2:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col2:last-child {
        margin-right: 0
    }

    .u-grid__col2:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col2:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col3 {
        width: calc(99.99%*3/12 - 22.5px)
    }

    .u-grid__col3:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col3:last-child {
        margin-right: 0
    }

    .u-grid__col3:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col3:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col4 {
        width: calc(99.99%*4/12 - 20px)
    }

    .u-grid__col4:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col4:last-child {
        margin-right: 0
    }

    .u-grid__col4:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col4:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col5 {
        width: calc(99.99%*5/12 - 17.5px)
    }

    .u-grid__col5:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col5:last-child {
        margin-right: 0
    }

    .u-grid__col5:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col5:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col6 {
        width: calc(99.99%*6/12 - 15px)
    }

    .u-grid__col6:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col6:last-child {
        margin-right: 0
    }

    .u-grid__col6:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col6:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col7 {
        width: calc(99.99%*7/12 - 12.5px)
    }

    .u-grid__col7:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col7:last-child {
        margin-right: 0
    }

    .u-grid__col7:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col7:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col8 {
        width: calc(99.99%*8/12 - 10px)
    }

    .u-grid__col8:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col8:last-child {
        margin-right: 0
    }

    .u-grid__col8:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col8:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col9 {
        width: calc(99.99%*9/12 - 7.5px)
    }

    .u-grid__col9:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col9:last-child {
        margin-right: 0
    }

    .u-grid__col9:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col9:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col10 {
        width: calc(99.99%*10/12 - 5px)
    }

    .u-grid__col10:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col10:last-child {
        margin-right: 0
    }

    .u-grid__col10:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col10:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col11 {
        width: calc(99.99%*11/12 - 2.5px)
    }

    .u-grid__col11:nth-child(1n) {
        float: left;
        margin-right: 30px;
        clear: none
    }

    .u-grid__col11:last-child {
        margin-right: 0
    }

    .u-grid__col11:nth-child(12n) {
        margin-right: 0;
        float: right
    }

    .u-grid__col11:nth-child(12n+1) {
        clear: left
    }

    .u-grid__col12,
    .u-width--full {
        width: 100%
    }

    .u-width--one-half {
        width: 50%
    }

    .u-width--one-third {
        width: 33.33333%
    }

    .u-width--one-fourth {
        width: 25%
    }

    .u-width--one-fifth {
        width: 20%
    }

    .u-width--one-sixth {
        width: 16.66667%
    }

    .u-width--one-seventh {
        width: 14.28571%
    }

    .u-width--one-eight {
        width: 12.5%
    }

    .u-width--one-nineth {
        width: 11.11111%
    }

    .u-width--one-tenth {
        width: 10%
    }

    .u-group:after {
        content: "";
        display: block;
        clear: both
    }

    .u-spc-top--tny {
        margin-top: 6px
    }

    .u-spc-top--sml {
        margin-top: 12px
    }

    .u-spc-top--med {
        margin-top: 24px
    }

    .u-spc-top--lrg {
        margin-top: 36px
    }

    .u-spc-top--xlrg {
        margin-top: 48px
    }

    .u-spc-right--tny {
        margin-right: 6px
    }

    .u-spc-right--sml {
        margin-right: 12px
    }

    .u-spc-right--med {
        margin-right: 24px
    }

    .u-spc-right--lrg {
        margin-right: 36px
    }

    .u-spc-right--xlrg {
        margin-right: 48px
    }

    .u-spc-bottom--tny {
        margin-bottom: 6px
    }

    .u-spc-bottom--sml {
        margin-bottom: 12px
    }

    .u-spc-bottom--med {
        margin-bottom: 24px
    }

    .u-spc-bottom--lrg {
        margin-bottom: 36px
    }

    .u-spc-bottom--xlrg {
        margin-bottom: 48px
    }

    .u-spc-left--tny {
        margin-left: 6px
    }

    .u-spc-left--sml {
        margin-left: 12px
    }

    .u-spc-left--med {
        margin-left: 24px
    }

    .u-spc-left--lrg {
        margin-left: 36px
    }

    .u-spc-left--xlrg {
        margin-left: 48px
    }

    .u-type--bold {
        font-weight: 700
    }

    .u-type--light {
        font-weight: 300
    }

    .u-type--alt {
        font-family: futura-pt-condensed, Helvetica, Arial, sans-serif
    }

    .u-type--center {
        text-align: center
    }

    .u-type--upper {
        text-transform: uppercase;
        letter-spacing: .15em
    }

    .u-type--alpha {
        font-size: 42px;
        line-height: 42px
    }

    @media(min-width:48em) {
        .u-type--alpha {
            font-size: 50px;
            line-height: 54px
        }
    }

    .u-type--beta {
        font-size: 34px;
        line-height: 42px
    }

    @media(min-width:48em) {
        .u-type--beta {
            font-size: 42px;
            line-height: 42px
        }
    }

    .u-type--gamma {
        font-size: 26px;
        line-height: 30px
    }

    @media(min-width:48em) {
        .u-type--gamma {
            font-size: 34px;
            line-height: 42px
        }
    }

    .u-type--delta {
        font-family: brandon-grotesque, Helvetica, Arial, sans-serif!important;
        font-size: 18px!important;
        line-height: 24px!important
    }

    @media(min-width:48em) {
        .u-type--delta {
            font-family: brandon-grotesque, Helvetica, Arial, sans-serif!important;
            font-size: 26px!important;
            line-height: 30px!important
        }
    }

    .u-type--epsilon {
        font-size: 16px;
        line-height: 18px
    }

    @media(min-width:48em) {
        .u-type--epsilon {
            font-size: 18px;
            line-height: 24px
        }
    }

    .u-type--zeta {
        font-size: 14px;
        line-height: 18px
    }

    @media(min-width:48em) {
        .u-type--zeta {
            font-size: 16px;
            line-height: 18px
        }
    }

    .u-type--eta {
        font-size: 12px;
        line-height: 12px
    }

    @media(min-width:48em) {
        .u-type--eta {
            font-size: 14px;
            line-height: 18px
        }
    }

    .u-type--primary {
        color: #0075bc
    }

    .u-type--secondary {
        color: green
    }

    .u-type--neutral {
        color: #7c7c7c
    }

    .u-type--negative {
        color: #fff
    }

    .u-type--shorten {
        overflow-wrap: break-word;
        word-wrap: break-word;
        -ms-word-break: break-all;
        word-break: break-all;
        word-break: break-word;
        -ms-hyphens: auto;
        -webkit-hyphens: auto;
        hyphens: auto
    }

    .u-radial {
        border-radius: 4px
    }

    .u-rounded {
        border-radius: 1000px
    }

    .u-float--left {
        float: left
    }

    .u-float--right {
        float: right
    }

    .u-pos--rel {
        position: relative
    }

    .u-pos--absolute {
        position: absolute
    }

    .u-bg--primary {
        background: #0075bc
    }

    .u-bg--dark {
        background: #212125
    }

    .u-bg--pattern {
        background-image: url(../images/pattern.svg);
        background-size: cover
    }

    .u-bg--ocean {
        background: url(../images/aida-ocean.jpg) no-repeat center center;
        background-size: cover;
        background-attachment: fixed
    }

    @media(min-width:48em) {
        .u-bg--ocean {
            background-size: 100%
        }
    }

    .u-bg--pooldiver {
        background: url(../images/aida-pooldiver.jpg) no-repeat center center;
        background-size: cover
    }

    .u-bg--surface {
        background: url(../images/aida-surface.jpg) no-repeat right center;
        background-size: cover
    }

    .u-bg--poolpeople {
        background: url(../images/aida-poolpeople.jpg) no-repeat center center;
        background-size: cover
    }

    .u-bg--blueoverlay {
        background-color: #0075bc;
        background-blend-mode: multiply
    }

    .u-bg--blueoverlaydark {
        background-color: #263a62;
        background-blend-mode: multiply
    }

    .u-well--bordered {
        padding-bottom: 24px;
        border-bottom: 1px solid #dedede
    }

    .u-actionlist__item {
        overflow: hidden;
        padding: 24px 0;
        border-bottom: 1px solid #d4d5d5
    }

    .u-actionlist__content {
        float: left;
        width: 55%;
        margin-right: 5%
    }

    .u-actionlist__action {
        float: left;
        width: 40%
    }

    .u-animation--fadeInSection {
        transition: all .35s ease-in-out;
        opacity: .4;
        transform: translateY(48px)
    }

    .u-animation--fadeInWithMove {
        opacity: 1;
        transform: translateY(0)
    }

    .is-hidden {
        display: none
    }

    .is-visible {
        display: block
    }

    .is-ontop {
        position: relative;
        z-index: 1
    }

    .u-color--success {
        color: #4caf50
    }

    .u-color--warning {
        color: #f44336
    }

    .u-color--note {
        color: #e2ba45
    }

    .picker {
        font-size: 14px;
        text-align: left;
        line-height: 1.2;
        color: #000;
        position: absolute;
        z-index: 10000;
        -webkit-user-select: none;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none
    }

    .picker__input {
        cursor: default
    }

    .picker__input.picker__input--active {
        border-color: #0089ec
    }

    .picker__holder {
        width: 100%;
        overflow-y: auto;
        -webkit-overflow-scrolling: touch
    }

    .picker__frame,
    .picker__holder {
        top: 0;
        bottom: 0;
        left: 0;
        right: 0;
        transform: translateY(100%)
    }

    .picker__holder {
        position: fixed;
        transition: background .15s ease-out, transform 0s .15s;
        -webkit-backface-visibility: hidden
    }

    .picker__frame {
        position: absolute;
        margin: 0 auto;
        min-width: 256px;
        max-width: 666px;
        width: 100%;
        opacity: 0;
        transition: all .15s ease-out
    }

    @media(min-height:33.875em) {
        .picker__frame {
            overflow: visible;
            top: auto;
            bottom: -100%;
            max-height: 80%
        }
    }

    @media(min-height:40.125em) {
        .picker__frame {
            margin-bottom: 7.5%
        }
    }

    .picker__wrap {
        display: table;
        width: 100%;
        height: 100%
    }

    @media(min-height:33.875em) {
        .picker__wrap {
            display: block
        }
    }

    .picker__box {
        background: #fff;
        display: table-cell;
        vertical-align: middle
    }

    @media(min-height:26.5em) {
        .picker__box {
            font-size: 1.25em
        }
    }

    @media(min-height:33.875em) {
        .picker__box {
            display: block;
            font-size: 1.33em;
            border: 1px solid #777;
            border-top-color: #898989;
            border-bottom-width: 0;
            border-radius: 5px 5px 0 0;
            box-shadow: 0 12px 36px 16px rgba(0, 0, 0, .24)
        }
    }

    @media(min-height:40.125em) {
        .picker__box {
            font-size: 1.5em;
            border-bottom-width: 1px;
            border-radius: 5px
        }
    }

    .picker--opened .picker__holder {
        transform: translateY(0);
        background: transparent;
        zoom: 1;
        background: rgba(0, 0, 0, .32);
        transition: background .15s ease-out
    }

    .picker--opened .picker__frame {
        transform: translateY(0);
        opacity: 1
    }

    @media(min-height:33.875em) {
        .picker--opened .picker__frame {
            top: auto;
            bottom: 0
        }
    }

    .picker__header {
        text-align: center;
        position: relative;
        padding: .75em 0;
        border-bottom: 1px solid #eee
    }

    .picker__month,
    .picker__year {
        font-weight: 500;
        display: inline-block;
        margin-left: .25em;
        margin-right: .25em
    }

    .picker__year {
        color: #999;
        font-size: .8em;
        font-style: italic
    }

    .picker__select--month,
    .picker__select--year {
        border: 0;
        border-bottom: 1px solid #b7b7b7;
        margin-left: .25em;
        margin-right: .25em
    }

    .picker__select--month {
        width: 35%
    }

    .picker__select--year {
        width: 22.5%
    }

    .picker__select--month:focus,
    .picker__select--year:focus {
        border-color: #0089ec
    }

    .picker__nav--next,
    .picker__nav--prev {
        position: absolute;
        padding: .75em 1.25em .5em;
        width: 1em;
        height: 1em;
        box-sizing: content-box;
        top: .5em
    }

    .picker__nav--prev {
        left: 0;
        padding-right: 1.25em
    }

    @media(min-width:24.5em) {
        .picker__nav--prev {
            padding-right: 1.5em
        }
    }

    .picker__nav--next {
        right: 0;
        padding-left: 1.25em
    }

    @media(min-width:24.5em) {
        .picker__nav--next {
            padding-left: 1.5em
        }
    }

    .picker__nav--next:before,
    .picker__nav--prev:before {
        content: " ";
        border-top: .25em solid transparent;
        border-bottom: .25em solid transparent;
        border-right: .375em solid #333;
        width: 0;
        height: 0;
        display: block;
        margin: 0 auto
    }

    .picker__nav--next:before {
        border-right: 0;
        border-left: .375em solid #333
    }

    .picker__nav--next:hover,
    .picker__nav--prev:hover {
        cursor: pointer;
        color: #333;
        background: #b1dcfb
    }

    .picker__nav--disabled,
    .picker__nav--disabled:before,
    .picker__nav--disabled:before:hover,
    .picker__nav--disabled:hover {
        cursor: default;
        background: none;
        border-right-color: #f5f5f5;
        border-left-color: #f5f5f5
    }

    .picker__table {
        text-align: center;
        border-collapse: collapse;
        border-spacing: 0;
        table-layout: fixed;
        font-size: inherit;
        width: 100%;
        margin-top: .75em;
        margin-bottom: .5em
    }

    @media(min-height:33.875em) {
        .picker__table {
            margin-bottom: .75em
        }
    }

    .picker__table td {
        margin: 0;
        padding: 0
    }

    .picker__weekday {
        width: 14.285714286%;
        font-size: .75em;
        padding-bottom: .25em;
        color: #999;
        font-weight: 400;
        text-align: center
    }

    @media(min-height:33.875em) {
        .picker__weekday {
            padding-bottom: .5em
        }
    }

    .picker__day {
        padding: .3125em 0;
        font-weight: 200;
        border: 1px solid transparent
    }

    .picker__day--today {
        position: relative
    }

    .picker__day--today:before {
        content: " ";
        position: absolute;
        top: 2px;
        right: 2px;
        width: 0;
        height: 0;
        border-top: .5em solid #0059bc;
        border-left: .5em solid transparent
    }

    .picker__day--disabled:before {
        border-top-color: #aaa
    }

    .picker__day--outfocus {
        color: #ddd
    }

    .picker__day--infocus:hover,
    .picker__day--outfocus:hover {
        cursor: pointer;
        color: #000;
        background: #b1dcfb
    }

    .picker--focused .picker__day--highlighted,
    .picker__day--highlighted:hover {
        cursor: pointer;
        color: #000;
        background: #b1dcfb
    }

    .picker--focused .picker__day--selected,
    .picker__day--selected,
    .picker__day--selected:hover {
        background: #0089ec;
        color: #fff
    }

    .picker--focused .picker__day--disabled,
    .picker__day--disabled,
    .picker__day--disabled:hover {
        background: #f5f5f5;
        border-color: #f5f5f5;
        color: #ddd;
        cursor: default
    }

    .picker__day--highlighted.picker__day--disabled,
    .picker__day--highlighted.picker__day--disabled:hover {
        background: #bbb
    }

    .picker__footer {
        text-align: center
    }

    .picker__button--clear,
    .picker__button--close,
    .picker__button--today {
        border: 1px solid #fff;
        background: #fff;
        font-size: .8em;
        padding: .66em 0;
        font-weight: 700;
        width: 33.3333%;
        display: inline-block;
        vertical-align: bottom
    }

    .picker__button--clear:hover,
    .picker__button--close:hover,
    .picker__button--today:hover {
        cursor: pointer;
        color: #000;
        background: #b1dcfb;
        border-bottom-color: #b1dcfb
    }

    .picker__button--clear:focus,
    .picker__button--close:focus,
    .picker__button--today:focus {
        background: #b1dcfb;
        border-color: #0089ec;
        outline: none
    }

    .picker__button--clear:before,
    .picker__button--close:before,
    .picker__button--today:before {
        position: relative;
        display: inline-block;
        height: 0
    }

    .picker__button--clear:before,
    .picker__button--today:before {
        content: " ";
        margin-right: .45em
    }

    .picker__button--today:before {
        top: -.05em;
        width: 0;
        border-top: .66em solid #0059bc;
        border-left: .66em solid transparent
    }

    .picker__button--clear:before {
        top: -.25em;
        width: .66em;
        border-top: 3px solid #e20
    }

    .picker__button--close:before {
        content: "×";
        top: -.1em;
        vertical-align: top;
        font-size: 1.1em;
        margin-right: .35em;
        color: #777
    }

    .picker__button--today[disabled],
    .picker__button--today[disabled]:hover {
        background: #f5f5f5;
        border-color: #f5f5f5;
        color: #ddd;
        cursor: default
    }

    .picker__button--today[disabled]:before {
        border-top-color: #aaa
    }

    .picker__list {
        list-style: none;
        padding: .75em 0 4.2em;
        margin: 0
    }

    .picker__list-item {
        border-bottom: 1px solid #ddd;
        border-top: 1px solid #ddd;
        margin-bottom: -1px;
        position: relative;
        background: #fff;
        padding: .75em 1.25em
    }

    @media(min-height:46.75em) {
        .picker__list-item {
            padding: .5em 1em
        }
    }

    .picker__list-item:hover {
        cursor: pointer;
        color: #000;
        background: #b1dcfb
    }

    .picker__list-item--highlighted,
    .picker__list-item:hover {
        border-color: #0089ec;
        z-index: 10
    }

    .picker--focused .picker__list-item--highlighted,
    .picker__list-item--highlighted:hover {
        cursor: pointer;
        color: #000;
        background: #b1dcfb
    }

    .picker--focused .picker__list-item--selected,
    .picker__list-item--selected,
    .picker__list-item--selected:hover {
        background: #0089ec;
        color: #fff;
        z-index: 10
    }

    .picker--focused .picker__list-item--disabled,
    .picker__list-item--disabled,
    .picker__list-item--disabled:hover {
        background: #f5f5f5;
        border-color: #f5f5f5;
        color: #ddd;
        cursor: default;
        border-color: #ddd;
        z-index: auto
    }

    .picker--time .picker__button--clear {
        display: block;
        width: 80%;
        margin: 1em auto 0;
        padding: 1em 1.25em;
        background: none;
        border: 0;
        font-weight: 500;
        font-size: .67em;
        text-align: center;
        text-transform: uppercase;
        color: #666
    }

    .picker--time .picker__button--clear:focus,
    .picker--time .picker__button--clear:hover {
        color: #000;
        background: #b1dcfb;
        background: #e20;
        border-color: #e20;
        cursor: pointer;
        color: #fff;
        outline: none
    }

    .picker--time .picker__button--clear:before {
        top: -.25em;
        color: #666;
        font-size: 1.25em;
        font-weight: 700
    }

    .picker--time .picker__button--clear:focus:before,
    .picker--time .picker__button--clear:hover:before {
        color: #fff;
        border-color: #fff
    }

    .picker--time .picker__frame {
        min-width: 256px;
        max-width: 320px
    }

    .picker--time .picker__box {
        font-size: 1em;
        background: #f2f2f2;
        padding: 0
    }

    @media(min-height:40.125em) {
        .picker--time .picker__box {
            margin-bottom: 5em
        }
    }

    .select2-container {
        box-sizing: border-box;
        display: inline-block;
        margin: 0;
        position: relative;
        vertical-align: middle
    }

    .select2-container .select2-selection--single {
        box-sizing: border-box;
        cursor: pointer;
        display: block;
        height: 36px;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none;
        -webkit-user-select: none
    }

    .select2-container .select2-selection--single .select2-selection__rendered {
        display: block;
        padding-left: 0;
        padding-right: 20px;
        overflow: hidden;
        text-overflow: ellipsis;
        white-space: nowrap
    }

    .select2-container .select2-selection--single .select2-selection__clear {
        position: relative
    }

    .select2-container[dir=rtl] .select2-selection--single .select2-selection__rendered {
        padding-right: 8px;
        padding-left: 20px
    }

    .select2-container .select2-selection--multiple {
        box-sizing: border-box;
        cursor: pointer;
        display: block;
        min-height: 32px;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none;
        -webkit-user-select: none
    }

    .select2-container .select2-selection--multiple .select2-selection__rendered {
        display: inline-block;
        overflow: hidden;
        padding-left: 8px;
        text-overflow: ellipsis;
        white-space: nowrap
    }

    .select2-container .select2-search--inline {
        float: left
    }

    .select2-container .select2-search--inline .select2-search__field {
        box-sizing: border-box;
        border: none;
        font-size: 100%;
        margin-top: 8px;
        padding: 0
    }

    .select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button {
        -webkit-appearance: none
    }

    .select2-dropdown {
        background-color: #fff;
        border: 1px solid #c4c4c4;
        box-shadow: 0 0 10px #c4c4c4;
        box-sizing: border-box;
        display: block;
        position: absolute;
        left: -100000px;
        width: 100%;
        z-index: 1051
    }

    .select2-results {
        display: block;
        padding: 12px
    }

    .select2-results__options {
        list-style: none;
        margin: 0;
        padding: 0
    }

    .select2-results__option {
        padding: 6px;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none;
        -webkit-user-select: none
    }

    .select2-results__option[aria-selected] {
        cursor: pointer
    }

    .select2-container--open .select2-dropdown {
        left: 0
    }

    .select2-container--open .select2-dropdown--above {
        border-bottom: none;
        border-bottom-left-radius: 0;
        border-bottom-right-radius: 0
    }

    .select2-container--open .select2-dropdown--below {
        border-top: none;
        border-top-left-radius: 0;
        border-top-right-radius: 0
    }

    .select2-search--dropdown {
        display: block;
        padding: 12px 12px 0 18px
    }

    .select2-search--dropdown .select2-search__field {
        padding: 6px 0;
        width: 100%;
        box-sizing: border-box
    }

    .select2-search--dropdown .select2-search__field::-webkit-search-cancel-button {
        -webkit-appearance: none
    }

    .select2-search--dropdown.select2-search--hide {
        display: none
    }

    .select2-close-mask {
        border: 0;
        margin: 0;
        padding: 0;
        display: block;
        position: fixed;
        left: 0;
        top: 0;
        min-height: 100%;
        min-width: 100%;
        height: auto;
        width: auto;
        opacity: 0;
        z-index: 99;
        background-color: #fff;
        filter: alpha(opacity=0)
    }

    .select2-hidden-accessible {
        border: 0!important;
        clip: rect(0 0 0 0)!important;
        height: 1px!important;
        margin: -1px!important;
        overflow: hidden!important;
        padding: 0!important;
        position: absolute!important;
        width: 1px!important
    }

    .select2-container--default .select2-selection--single {
        background-color: #fff;
        border-bottom: 1px solid #c4c4c4
    }

    .select2-container--default .select2-selection--single .select2-selection__rendered {
        color: #444;
        line-height: 36px
    }

    .select2-container--default .select2-selection--single .select2-selection__clear {
        cursor: pointer;
        float: right;
        font-weight: 700
    }

    .select2-container--default .select2-selection--single .select2-selection__placeholder {
        color: #999
    }

    .select2-container--default .select2-selection--single .select2-selection__arrow {
        height: 26px;
        position: absolute;
        top: 4px;
        right: 2px;
        width: 12px
    }

    .select2-container--default .select2-selection--single .select2-selection__arrow b {
        border-color: #444 transparent transparent;
        border-style: solid;
        border-width: 6px 3px 0;
        height: 0;
        left: 50%;
        margin-left: -4px;
        margin-top: -2px;
        position: absolute;
        top: 50%;
        width: 0
    }

    .select2-container--default[dir=rtl] .select2-selection--single .select2-selection__clear {
        float: left
    }

    .select2-container--default[dir=rtl] .select2-selection--single .select2-selection__arrow {
        left: 1px;
        right: auto
    }

    .select2-container--default.select2-container--disabled .select2-selection--single {
        background-color: #eee;
        cursor: default
    }

    .select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear {
        display: none
    }

    .select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b {
        border-color: transparent transparent #888;
        border-width: 0 4px 5px
    }

    .select2-container--default .select2-selection--multiple {
        background-color: #fff;
        border-bottom: 1px solid #c4c4c4;
        cursor: text
    }

    .select2-container--default .select2-selection--multiple .select2-selection__rendered {
        box-sizing: border-box;
        list-style: none;
        margin: 0;
        padding: 0;
        width: 100%
    }

    .select2-container--default .select2-selection--multiple .select2-selection__rendered li {
        list-style: none
    }

    .select2-container--default .select2-selection--multiple .select2-selection__placeholder {
        color: #999;
        margin-top: 5px;
        float: left
    }

    .select2-container--default .select2-selection--multiple .select2-selection__clear {
        cursor: pointer;
        float: right;
        font-weight: 700;
        margin-top: 5px;
        margin-right: 10px
    }

    .select2-container--default .select2-selection--multiple .select2-selection__choice {
        background-color: #505c69;
        cursor: default;
        float: left;
        margin-right: 5px;
        margin-top: 5px;
        padding: 8px 12px 8px 8px;
        font-size: 16px;
        color: #fff;
        border-radius: 4px
    }

    .select2-container--default .select2-selection--multiple .select2-selection__choice__remove {
        cursor: pointer;
        display: inline-block;
        font-size: 16px;
        font-weight: 700;
        margin: 0 12px 0 6px;
        color: hsla(0, 0%, 100%, .7)
    }

    .select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover {
        color: #fff
    }

    .select2-container--default[dir=rtl] .select2-selection--multiple .select2-search--inline,
    .select2-container--default[dir=rtl] .select2-selection--multiple .select2-selection__choice,
    .select2-container--default[dir=rtl] .select2-selection--multiple .select2-selection__placeholder {
        float: right
    }

    .select2-container--default[dir=rtl] .select2-selection--multiple .select2-selection__choice {
        margin-left: 5px;
        margin-right: auto
    }

    .select2-container--default[dir=rtl] .select2-selection--multiple .select2-selection__choice__remove {
        margin-left: 2px;
        margin-right: auto
    }

    .select2-container--default.select2-container--focus .select2-selection--multiple {
        border-bottom-color: #0075bc;
        outline: 0
    }

    .select2-container--default.select2-container--disabled .select2-selection--multiple {
        background-color: #eee;
        cursor: default
    }

    .select2-container--default.select2-container--disabled .select2-selection__choice__remove {
        display: none
    }

    .select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple,
    .select2-container--default.select2-container--open.select2-container--above .select2-selection--single {
        border-top-left-radius: 0;
        border-top-right-radius: 0
    }

    .select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple,
    .select2-container--default.select2-container--open.select2-container--below .select2-selection--single {
        border-bottom-left-radius: 0;
        border-bottom-right-radius: 0
    }

    .select2-container--default .select2-search--dropdown .select2-search__field {
        border: 0;
        border-bottom: 1px solid #c4c4c4
    }

    .select2-container--default .select2-search--dropdown .select2-search__field:focus {
        outline: 0;
        border-bottom-color: #0075bc
    }

    .select2-container--default .select2-search--inline .select2-search__field {
        background: transparent;
        border: none;
        outline: 0;
        box-shadow: none;
        -webkit-appearance: textfield
    }

    .select2-container--default .select2-results > .select2-results__options {
        max-height: 200px;
        overflow-y: auto
    }

    .select2-container--default .select2-results__option[role=group] {
        padding: 0
    }

    .select2-container--default .select2-results__option[aria-disabled=true] {
        color: #999
    }

    .select2-container--default .select2-results__option[aria-selected=true] {
        background-color: #ddd
    }

    .select2-container--default .select2-results__option .select2-results__option {
        padding-left: 1em
    }

    .select2-container--default .select2-results__option .select2-results__option .select2-results__group {
        padding-left: 0
    }

    .select2-container--default .select2-results__option .select2-results__option .select2-results__option {
        margin-left: -1em;
        padding-left: 2em
    }

    .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
        margin-left: -2em;
        padding-left: 3em
    }

    .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
        margin-left: -3em;
        padding-left: 4em
    }

    .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
        margin-left: -4em;
        padding-left: 5em
    }

    .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
        margin-left: -5em;
        padding-left: 6em
    }

    .select2-container--default .select2-results__option--highlighted[aria-selected] {
        background-color: #0075bc;
        color: #fff
    }

    .select2-container--default .select2-results__group {
        cursor: default;
        display: block;
        padding: 6px
    }

    .select2-container--classic .select2-selection--single {
        background-color: #f7f7f7;
        border: 1px solid #aaa;
        outline: 0;
        background-image: linear-gradient(180deg, #fff 50%, #eee);
        background-repeat: repeat-x;
        filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)
    }

    .select2-container--classic .select2-selection--single:focus {
        border: 1px solid #0075bc
    }

    .select2-container--classic .select2-selection--single .select2-selection__rendered {
        color: #444;
        line-height: 28px
    }

    .select2-container--classic .select2-selection--single .select2-selection__clear {
        cursor: pointer;
        float: right;
        font-weight: 700;
        margin-right: 10px
    }

    .select2-container--classic .select2-selection--single .select2-selection__placeholder {
        color: #999
    }

    .select2-container--classic .select2-selection--single .select2-selection__arrow {
        background-color: #ddd;
        border: none;
        border-left: 1px solid #aaa;
        border-top-right-radius: 4px;
        border-bottom-right-radius: 4px;
        height: 26px;
        position: absolute;
        top: 1px;
        right: 1px;
        width: 20px;
        background-image: linear-gradient(180deg, #eee 50%, #ccc);
        background-repeat: repeat-x;
        filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)
    }

    .select2-container--classic .select2-selection--single .select2-selection__arrow b {
        border-color: #888 transparent transparent;
        border-style: solid;
        border-width: 5px 4px 0;
        height: 0;
        left: 50%;
        margin-left: -4px;
        margin-top: -2px;
        position: absolute;
        top: 50%;
        width: 0
    }

    .select2-container--classic[dir=rtl] .select2-selection--single .select2-selection__clear {
        float: left
    }

    .select2-container--classic[dir=rtl] .select2-selection--single .select2-selection__arrow {
        border: none;
        border-right: 1px solid #aaa;
        border-radius: 0;
        border-top-left-radius: 4px;
        border-bottom-left-radius: 4px;
        left: 1px;
        right: auto
    }

    .select2-container--classic.select2-container--open .select2-selection--single {
        border: 1px solid #0075bc
    }

    .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow {
        background: transparent;
        border: none
    }

    .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b {
        border-color: transparent transparent #888;
        border-width: 0 4px 5px
    }

    .select2-container--classic.select2-container--open.select2-container--above .select2-selection--single {
        border-top: none;
        border-top-left-radius: 0;
        border-top-right-radius: 0;
        background-image: linear-gradient(180deg, #fff 0, #eee 50%);
        background-repeat: repeat-x;
        filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)
    }

    .select2-container--classic.select2-container--open.select2-container--below .select2-selection--single {
        border-bottom: none;
        border-bottom-left-radius: 0;
        border-bottom-right-radius: 0;
        background-image: linear-gradient(180deg, #eee 50%, #fff);
        background-repeat: repeat-x;
        filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)
    }

    .select2-container--classic .select2-selection--multiple {
        background-color: #fff;
        border: 1px solid #aaa;
        cursor: text;
        outline: 0
    }

    .select2-container--classic .select2-selection--multiple:focus {
        border: 1px solid #0075bc
    }

    .select2-container--classic .select2-selection--multiple .select2-selection__rendered {
        list-style: none;
        margin: 0;
        padding: 0 5px
    }

    .select2-container--classic .select2-selection--multiple .select2-selection__clear {
        display: none
    }

    .select2-container--classic .select2-selection--multiple .select2-selection__choice {
        background-color: #e4e4e4;
        border: 1px solid #aaa;
        cursor: default;
        float: left;
        margin-right: 5px;
        margin-top: 5px;
        padding: 0 5px
    }

    .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove {
        color: #888;
        cursor: pointer;
        display: inline-block;
        font-weight: 700;
        margin-right: 2px
    }

    .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover {
        color: #555
    }

    .select2-container--classic[dir=rtl] .select2-selection--multiple .select2-selection__choice {
        float: right;
        margin-left: 5px;
        margin-right: auto
    }

    .select2-container--classic[dir=rtl] .select2-selection--multiple .select2-selection__choice__remove {
        margin-left: 2px;
        margin-right: auto
    }

    .select2-container--classic.select2-container--open .select2-selection--multiple {
        border: 1px solid #0075bc
    }

    .select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple {
        border-top: none;
        border-top-left-radius: 0;
        border-top-right-radius: 0
    }

    .select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple {
        border-bottom: none;
        border-bottom-left-radius: 0;
        border-bottom-right-radius: 0
    }

    .select2-container--classic .select2-search--dropdown .select2-search__field {
        border: 1px solid #aaa;
        outline: 0
    }

    .select2-container--classic .select2-search--inline .select2-search__field {
        outline: 0;
        box-shadow: none
    }

    .select2-container--classic .select2-dropdown {
        background-color: #fff;
        border: 1px solid transparent
    }

    .select2-container--classic .select2-dropdown--above {
        border-bottom: none
    }

    .select2-container--classic .select2-dropdown--below {
        border-top: none
    }

    .select2-container--classic .select2-results > .select2-results__options {
        max-height: 200px;
        overflow-y: auto
    }

    .select2-container--classic .select2-results__option[role=group] {
        padding: 0
    }

    .select2-container--classic .select2-results__option[aria-disabled=true] {
        color: grey
    }

    .select2-container--classic .select2-results__option--highlighted[aria-selected] {
        background-color: #3875d7;
        color: #fff
    }

    .select2-container--classic .select2-results__group {
        cursor: default;
        display: block;
        padding: 6px
    }

    .select2-container--classic.select2-container--open .select2-dropdown {
        border-color: #0075bc
    }

    @font-face {
        font-family: Ionicons;
        src: url(../fonts/Brandon_bld.otf);
        font-weight: 400;
        font-style: normal
    }

    .icon,
    .ion,
    .ionicons {
        display: inline-block;
        font-family: Ionicons;
        speak: none;
        font-style: normal;
        font-weight: 400;
        font-variant: normal;
        text-transform: none;
        text-rendering: auto;
        line-height: 1;
        -webkit-font-smoothing: antialiased;
        -moz-osx-font-smoothing: grayscale
    }

    .ion-alert:before {
        content: ""
    }

    .ion-alert-circled:before {
        content: ""
    }

    .ion-android-add:before {
        content: ""
    }

    .ion-android-add-circle:before {
        content: ""
    }

    .ion-android-alarm-clock:before {
        content: ""
    }

    .ion-android-alert:before {
        content: ""
    }

    .ion-android-apps:before {
        content: ""
    }

    .ion-android-archive:before {
        content: ""
    }

    .ion-android-arrow-back:before {
        content: ""
    }

    .ion-android-arrow-down:before {
        content: ""
    }

    .ion-android-arrow-dropdown:before {
        content: "▼"
    }

    .ion-android-arrow-dropdown-circle:before {
        content: ""
    }

    .ion-android-arrow-dropleft:before {
        content: ""
    }

    .ion-android-arrow-dropleft-circle:before {
        content: ""
    }

    .ion-android-arrow-dropright:before {
        content: ""
    }

    .ion-android-arrow-dropright-circle:before {
        content: ""
    }

    .ion-android-arrow-dropup:before {
        content: ""
    }

    .ion-android-arrow-dropup-circle:before {
        content: ""
    }

    .ion-android-arrow-forward:before {
        content: ""
    }

    .ion-android-arrow-up:before {
        content: ""
    }

    .ion-android-attach:before {
        content: ""
    }

    .ion-android-bar:before {
        content: ""
    }

    .ion-android-bicycle:before {
        content: ""
    }

    .ion-android-boat:before {
        content: ""
    }

    .ion-android-bookmark:before {
        content: ""
    }

    .ion-android-bulb:before {
        content: ""
    }

    .ion-android-bus:before {
        content: ""
    }

    .ion-android-calendar:before {
        content: ""
    }

    .ion-android-call:before {
        content: ""
    }

    .ion-android-camera:before {
        content: ""
    }

    .ion-android-cancel:before {
        content: ""
    }

    .ion-android-car:before {
        content: ""
    }

    .ion-android-cart:before {
        content: ""
    }

    .ion-android-chat:before {
        content: ""
    }

    .ion-android-checkbox:before {
        content: ""
    }

    .ion-android-checkbox-blank:before {
        content: ""
    }

    .ion-android-checkbox-outline:before {
        content: ""
    }

    .ion-android-checkbox-outline-blank:before {
        content: ""
    }

    .ion-android-checkmark-circle:before {
        content: ""
    }

    .ion-android-clipboard:before {
        content: ""
    }

    .ion-android-close:before {
        content: ""
    }

    .ion-android-cloud:before {
        content: ""
    }

    .ion-android-cloud-circle:before {
        content: ""
    }

    .ion-android-cloud-done:before {
        content: ""
    }

    .ion-android-cloud-outline:before {
        content: ""
    }

    .ion-android-color-palette:before {
        content: ""
    }

    .ion-android-compass:before {
        content: ""
    }

    .ion-android-contact:before {
        content: ""
    }

    .ion-android-contacts:before {
        content: ""
    }

    .ion-android-contract:before {
        content: ""
    }

    .ion-android-create:before {
        content: ""
    }

    .ion-android-delete:before {
        content: ""
    }

    .ion-android-desktop:before {
        content: ""
    }

    .ion-android-document:before {
        content: ""
    }

    .ion-android-done:before {
        content: ""
    }

    .ion-android-done-all:before {
        content: ""
    }

    .ion-android-download:before {
        content: ""
    }

    .ion-android-drafts:before {
        content: ""
    }

    .ion-android-exit:before {
        content: ""
    }

    .ion-android-expand:before {
        content: ""
    }

    .ion-android-favorite:before {
        content: ""
    }

    .ion-android-favorite-outline:before {
        content: ""
    }

    .ion-android-film:before {
        content: ""
    }

    .ion-android-folder:before {
        content: ""
    }

    .ion-android-folder-open:before {
        content: ""
    }

    .ion-android-funnel:before {
        content: ""
    }

    .ion-android-globe:before {
        content: ""
    }

    .ion-android-hand:before {
        content: ""
    }

    .ion-android-hangout:before {
        content: ""
    }

    .ion-android-happy:before {
        content: ""
    }

    .ion-android-home:before {
        content: ""
    }

    .ion-android-image:before {
        content: ""
    }

    .ion-android-laptop:before {
        content: ""
    }

    .ion-android-list:before {
        content: ""
    }

    .ion-android-locate:before {
        content: ""
    }

    .ion-android-lock:before {
        content: ""
    }

    .ion-android-mail:before {
        content: ""
    }

    .ion-android-map:before {
        content: ""
    }

    .ion-android-menu:before {
        content: ""
    }

    .ion-android-microphone:before {
        content: ""
    }

    .ion-android-microphone-off:before {
        content: ""
    }

    .ion-android-more-horizontal:before {
        content: ""
    }

    .ion-android-more-vertical:before {
        content: ""
    }

    .ion-android-navigate:before {
        content: ""
    }

    .ion-android-notifications:before {
        content: ""
    }

    .ion-android-notifications-none:before {
        content: ""
    }

    .ion-android-notifications-off:before {
        content: ""
    }

    .ion-android-open:before {
        content: ""
    }

    .ion-android-options:before {
        content: ""
    }

    .ion-android-people:before {
        content: ""
    }

    .ion-android-person:before {
        content: ""
    }

    .ion-android-person-add:before {
        content: ""
    }

    .ion-android-phone-landscape:before {
        content: ""
    }

    .ion-android-phone-portrait:before {
        content: ""
    }

    .ion-android-pin:before {
        content: ""
    }

    .ion-android-plane:before {
        content: ""
    }

    .ion-android-playstore:before {
        content: ""
    }

    .ion-android-print:before {
        content: ""
    }

    .ion-android-radio-button-off:before {
        content: ""
    }

    .ion-android-radio-button-on:before {
        content: ""
    }

    .ion-android-refresh:before {
        content: ""
    }

    .ion-android-remove:before {
        content: ""
    }

    .ion-android-remove-circle:before {
        content: ""
    }

    .ion-android-restaurant:before {
        content: ""
    }

    .ion-android-sad:before {
        content: ""
    }

    .ion-android-search:before {
        content: ""
    }

    .ion-android-send:before {
        content: ""
    }

    .ion-android-settings:before {
        content: ""
    }

    .ion-android-share:before {
        content: ""
    }

    .ion-android-share-alt:before {
        content: ""
    }

    .ion-android-star:before {
        content: ""
    }

    .ion-android-star-half:before {
        content: ""
    }

    .ion-android-star-outline:before {
        content: ""
    }

    .ion-android-stopwatch:before {
        content: ""
    }

    .ion-android-subway:before {
        content: ""
    }

    .ion-android-sunny:before {
        content: ""
    }

    .ion-android-sync:before {
        content: ""
    }

    .ion-android-textsms:before {
        content: ""
    }

    .ion-android-time:before {
        content: ""
    }

    .ion-android-train:before {
        content: ""
    }

    .ion-android-unlock:before {
        content: ""
    }

    .ion-android-upload:before {
        content: ""
    }

    .ion-android-volume-down:before {
        content: ""
    }

    .ion-android-volume-mute:before {
        content: ""
    }

    .ion-android-volume-off:before {
        content: ""
    }

    .ion-android-volume-up:before {
        content: ""
    }

    .ion-android-walk:before {
        content: ""
    }

    .ion-android-warning:before {
        content: ""
    }

    .ion-android-watch:before {
        content: ""
    }

    .ion-android-wifi:before {
        content: ""
    }

    .ion-aperture:before {
        content: ""
    }

    .ion-archive:before {
        content: ""
    }

    .ion-arrow-down-a:before {
        content: ""
    }

    .ion-arrow-down-b:before {
        content: ""
    }

    .ion-arrow-down-c:before {
        content: ""
    }

    .ion-arrow-expand:before {
        content: ""
    }

    .ion-arrow-graph-down-left:before {
        content: ""
    }

    .ion-arrow-graph-down-right:before {
        content: ""
    }

    .ion-arrow-graph-up-left:before {
        content: ""
    }

    .ion-arrow-graph-up-right:before {
        content: ""
    }

    .ion-arrow-left-a:before {
        content: ""
    }

    .ion-arrow-left-b:before {
        content: ""
    }

    .ion-arrow-left-c:before {
        content: ""
    }

    .ion-arrow-move:before {
        content: ""
    }

    .ion-arrow-resize:before {
        content: ""
    }

    .ion-arrow-return-left:before {
        content: ""
    }

    .ion-arrow-return-right:before {
        content: ""
    }

    .ion-arrow-right-a:before {
        content: ""
    }

    .ion-arrow-right-b:before {
        content: ""
    }

    .ion-arrow-right-c:before {
        content: ""
    }

    .ion-arrow-shrink:before {
        content: ""
    }

    .ion-arrow-swap:before {
        content: ""
    }

    .ion-arrow-up-a:before {
        content: ""
    }

    .ion-arrow-up-b:before {
        content: ""
    }

    .ion-arrow-up-c:before {
        content: ""
    }

    .ion-asterisk:before {
        content: ""
    }

    .ion-at:before {
        content: ""
    }

    .ion-backspace:before {
        content: ""
    }

    .ion-backspace-outline:before {
        content: ""
    }

    .ion-bag:before {
        content: ""
    }

    .ion-battery-charging:before {
        content: ""
    }

    .ion-battery-empty:before {
        content: ""
    }

    .ion-battery-full:before {
        content: ""
    }

    .ion-battery-half:before {
        content: ""
    }

    .ion-battery-low:before {
        content: ""
    }

    .ion-beaker:before {
        content: ""
    }

    .ion-beer:before {
        content: ""
    }

    .ion-bluetooth:before {
        content: ""
    }

    .ion-bonfire:before {
        content: ""
    }

    .ion-bookmark:before {
        content: ""
    }

    .ion-bowtie:before {
        content: ""
    }

    .ion-briefcase:before {
        content: ""
    }

    .ion-bug:before {
        content: ""
    }

    .ion-calculator:before {
        content: ""
    }

    .ion-calendar:before {
        content: ""
    }

    .ion-camera:before {
        content: ""
    }

    .ion-card:before {
        content: ""
    }

    .ion-cash:before {
        content: ""
    }

    .ion-chatbox:before {
        content: ""
    }

    .ion-chatbox-working:before {
        content: ""
    }

    .ion-chatboxes:before {
        content: ""
    }

    .ion-chatbubble:before {
        content: ""
    }

    .ion-chatbubble-working:before {
        content: ""
    }

    .ion-chatbubbles:before {
        content: ""
    }

    .ion-checkmark:before {
        content: ""
    }

    .ion-checkmark-circled:before {
        content: ""
    }

    .ion-checkmark-round:before {
        content: ""
    }

    .ion-chevron-down:before {
        content: ""
    }

    .ion-chevron-left:before {
        content: ""
    }

    .ion-chevron-right:before {
        content: ""
    }

    .ion-chevron-up:before {
        content: ""
    }

    .ion-clipboard:before {
        content: ""
    }

    .ion-clock:before {
        content: ""
    }

    .ion-close:before {
        content: ""
    }

    .ion-close-circled:before {
        content: ""
    }

    .ion-close-round:before {
        content: ""
    }

    .ion-closed-captioning:before {
        content: ""
    }

    .ion-cloud:before {
        content: ""
    }

    .ion-code:before {
        content: ""
    }

    .ion-code-download:before {
        content: ""
    }

    .ion-code-working:before {
        content: ""
    }

    .ion-coffee:before {
        content: ""
    }

    .ion-compass:before {
        content: ""
    }

    .ion-compose:before {
        content: ""
    }

    .ion-connection-bars:before {
        content: ""
    }

    .ion-contrast:before {
        content: ""
    }

    .ion-crop:before {
        content: ""
    }

    .ion-cube:before {
        content: ""
    }

    .ion-disc:before {
        content: ""
    }

    .ion-document:before {
        content: ""
    }

    .ion-document-text:before {
        content: ""
    }

    .ion-drag:before {
        content: ""
    }

    .ion-earth:before {
        content: ""
    }

    .ion-easel:before {
        content: ""
    }

    .ion-edit:before {
        content: ""
    }

    .ion-egg:before {
        content: ""
    }

    .ion-eject:before {
        content: ""
    }

    .ion-email:before {
        content: ""
    }

    .ion-email-unread:before {
        content: ""
    }

    .ion-erlenmeyer-flask:before {
        content: ""
    }

    .ion-erlenmeyer-flask-bubbles:before {
        content: ""
    }

    .ion-eye:before {
        content: ""
    }

    .ion-eye-disabled:before {
        content: ""
    }

    .ion-female:before {
        content: ""
    }

    .ion-filing:before {
        content: ""
    }

    .ion-film-marker:before {
        content: ""
    }

    .ion-fireball:before {
        content: ""
    }

    .ion-flag:before {
        content: ""
    }

    .ion-flame:before {
        content: ""
    }

    .ion-flash:before {
        content: ""
    }

    .ion-flash-off:before {
        content: ""
    }

    .ion-folder:before {
        content: ""
    }

    .ion-fork:before {
        content: ""
    }

    .ion-fork-repo:before {
        content: ""
    }

    .ion-forward:before {
        content: ""
    }

    .ion-funnel:before {
        content: ""
    }

    .ion-gear-a:before {
        content: ""
    }

    .ion-gear-b:before {
        content: ""
    }

    .ion-grid:before {
        content: ""
    }

    .ion-hammer:before {
        content: ""
    }

    .ion-happy:before {
        content: ""
    }

    .ion-happy-outline:before {
        content: ""
    }

    .ion-headphone:before {
        content: ""
    }

    .ion-heart:before {
        content: ""
    }

    .ion-heart-broken:before {
        content: ""
    }

    .ion-help:before {
        content: ""
    }

    .ion-help-buoy:before {
        content: ""
    }

    .ion-help-circled:before {
        content: ""
    }

    .ion-home:before {
        content: ""
    }

    .ion-icecream:before {
        content: ""
    }

    .ion-image:before {
        content: ""
    }

    .ion-images:before {
        content: ""
    }

    .ion-information:before {
        content: ""
    }

    .ion-information-circled:before {
        content: ""
    }

    .ion-ionic:before {
        content: ""
    }

    .ion-ios-alarm:before {
        content: ""
    }

    .ion-ios-alarm-outline:before {
        content: ""
    }

    .ion-ios-albums:before {
        content: ""
    }

    .ion-ios-albums-outline:before {
        content: ""
    }

    .ion-ios-americanfootball:before {
        content: ""
    }

    .ion-ios-americanfootball-outline:before {
        content: ""
    }

    .ion-ios-analytics:before {
        content: ""
    }

    .ion-ios-analytics-outline:before {
        content: ""
    }

    .ion-ios-arrow-back:before {
        content: ""
    }

    .ion-ios-arrow-down:before {
        content: ""
    }

    .ion-ios-arrow-forward:before {
        content: ""
    }

    .ion-ios-arrow-left:before {
        content: ""
    }

    .ion-ios-arrow-right:before {
        content: ""
    }

    .ion-ios-arrow-thin-down:before {
        content: ""
    }

    .ion-ios-arrow-thin-left:before {
        content: ""
    }

    .ion-ios-arrow-thin-right:before {
        content: ""
    }

    .ion-ios-arrow-thin-up:before {
        content: ""
    }

    .ion-ios-arrow-up:before {
        content: ""
    }

    .ion-ios-at:before {
        content: ""
    }

    .ion-ios-at-outline:before {
        content: ""
    }

    .ion-ios-barcode:before {
        content: ""
    }

    .ion-ios-barcode-outline:before {
        content: ""
    }

    .ion-ios-baseball:before {
        content: ""
    }

    .ion-ios-baseball-outline:before {
        content: ""
    }

    .ion-ios-basketball:before {
        content: ""
    }

    .ion-ios-basketball-outline:before {
        content: ""
    }

    .ion-ios-bell:before {
        content: ""
    }

    .ion-ios-bell-outline:before {
        content: ""
    }

    .ion-ios-body:before {
        content: ""
    }

    .ion-ios-body-outline:before {
        content: ""
    }

    .ion-ios-bolt:before {
        content: ""
    }

    .ion-ios-bolt-outline:before {
        content: ""
    }

    .ion-ios-book:before {
        content: ""
    }

    .ion-ios-book-outline:before {
        content: ""
    }

    .ion-ios-bookmarks:before {
        content: ""
    }

    .ion-ios-bookmarks-outline:before {
        content: ""
    }

    .ion-ios-box:before {
        content: ""
    }

    .ion-ios-box-outline:before {
        content: ""
    }

    .ion-ios-briefcase:before {
        content: ""
    }

    .ion-ios-briefcase-outline:before {
        content: ""
    }

    .ion-ios-browsers:before {
        content: ""
    }

    .ion-ios-browsers-outline:before {
        content: ""
    }

    .ion-ios-calculator:before {
        content: ""
    }

    .ion-ios-calculator-outline:before {
        content: ""
    }

    .ion-ios-calendar:before {
        content: ""
    }

    .ion-ios-calendar-outline:before {
        content: ""
    }

    .ion-ios-camera:before {
        content: ""
    }

    .ion-ios-camera-outline:before {
        content: ""
    }

    .ion-ios-cart:before {
        content: ""
    }

    .ion-ios-cart-outline:before {
        content: ""
    }

    .ion-ios-chatboxes:before {
        content: ""
    }

    .ion-ios-chatboxes-outline:before {
        content: ""
    }

    .ion-ios-chatbubble:before {
        content: ""
    }

    .ion-ios-chatbubble-outline:before {
        content: ""
    }

    .ion-ios-checkmark:before {
        content: ""
    }

    .ion-ios-checkmark-empty:before {
        content: ""
    }

    .ion-ios-checkmark-outline:before {
        content: ""
    }

    .ion-ios-circle-filled:before {
        content: ""
    }

    .ion-ios-circle-outline:before {
        content: ""
    }

    .ion-ios-clock:before {
        content: ""
    }

    .ion-ios-clock-outline:before {
        content: ""
    }

    .ion-ios-close:before {
        content: ""
    }

    .ion-ios-close-empty:before {
        content: ""
    }

    .ion-ios-close-outline:before {
        content: ""
    }

    .ion-ios-cloud:before {
        content: ""
    }

    .ion-ios-cloud-download:before {
        content: ""
    }

    .ion-ios-cloud-download-outline:before {
        content: ""
    }

    .ion-ios-cloud-outline:before {
        content: ""
    }

    .ion-ios-cloud-upload:before {
        content: ""
    }

    .ion-ios-cloud-upload-outline:before {
        content: ""
    }

    .ion-ios-cloudy:before {
        content: ""
    }

    .ion-ios-cloudy-night:before {
        content: ""
    }

    .ion-ios-cloudy-night-outline:before {
        content: ""
    }

    .ion-ios-cloudy-outline:before {
        content: ""
    }

    .ion-ios-cog:before {
        content: ""
    }

    .ion-ios-cog-outline:before {
        content: ""
    }

    .ion-ios-color-filter:before {
        content: ""
    }

    .ion-ios-color-filter-outline:before {
        content: ""
    }

    .ion-ios-color-wand:before {
        content: ""
    }

    .ion-ios-color-wand-outline:before {
        content: ""
    }

    .ion-ios-compose:before {
        content: ""
    }

    .ion-ios-compose-outline:before {
        content: ""
    }

    .ion-ios-contact:before {
        content: ""
    }

    .ion-ios-contact-outline:before {
        content: ""
    }

    .ion-ios-copy:before {
        content: ""
    }

    .ion-ios-copy-outline:before {
        content: ""
    }

    .ion-ios-crop:before {
        content: ""
    }

    .ion-ios-crop-strong:before {
        content: ""
    }

    .ion-ios-download:before {
        content: ""
    }

    .ion-ios-download-outline:before {
        content: ""
    }

    .ion-ios-drag:before {
        content: ""
    }

    .ion-ios-email:before {
        content: ""
    }

    .ion-ios-email-outline:before {
        content: ""
    }

    .ion-ios-eye:before {
        content: ""
    }

    .ion-ios-eye-outline:before {
        content: ""
    }

    .ion-ios-fastforward:before {
        content: ""
    }

    .ion-ios-fastforward-outline:before {
        content: ""
    }

    .ion-ios-filing:before {
        content: ""
    }

    .ion-ios-filing-outline:before {
        content: ""
    }

    .ion-ios-film:before {
        content: ""
    }

    .ion-ios-film-outline:before {
        content: ""
    }

    .ion-ios-flag:before {
        content: ""
    }

    .ion-ios-flag-outline:before {
        content: ""
    }

    .ion-ios-flame:before {
        content: ""
    }

    .ion-ios-flame-outline:before {
        content: ""
    }

    .ion-ios-flask:before {
        content: ""
    }

    .ion-ios-flask-outline:before {
        content: ""
    }

    .ion-ios-flower:before {
        content: ""
    }

    .ion-ios-flower-outline:before {
        content: ""
    }

    .ion-ios-folder:before {
        content: ""
    }

    .ion-ios-folder-outline:before {
        content: ""
    }

    .ion-ios-football:before {
        content: ""
    }

    .ion-ios-football-outline:before {
        content: ""
    }

    .ion-ios-game-controller-a:before {
        content: ""
    }

    .ion-ios-game-controller-a-outline:before {
        content: ""
    }

    .ion-ios-game-controller-b:before {
        content: ""
    }

    .ion-ios-game-controller-b-outline:before {
        content: ""
    }

    .ion-ios-gear:before {
        content: ""
    }

    .ion-ios-gear-outline:before {
        content: ""
    }

    .ion-ios-glasses:before {
        content: ""
    }

    .ion-ios-glasses-outline:before {
        content: ""
    }

    .ion-ios-grid-view:before {
        content: ""
    }

    .ion-ios-grid-view-outline:before {
        content: ""
    }

    .ion-ios-heart:before {
        content: ""
    }

    .ion-ios-heart-outline:before {
        content: ""
    }

    .ion-ios-help:before {
        content: ""
    }

    .ion-ios-help-empty:before {
        content: ""
    }

    .ion-ios-help-outline:before {
        content: ""
    }

    .ion-ios-home:before {
        content: ""
    }

    .ion-ios-home-outline:before {
        content: ""
    }

    .ion-ios-infinite:before {
        content: ""
    }

    .ion-ios-infinite-outline:before {
        content: ""
    }

    .ion-ios-information:before {
        content: ""
    }

    .ion-ios-information-empty:before {
        content: ""
    }

    .ion-ios-information-outline:before {
        content: ""
    }

    .ion-ios-ionic-outline:before {
        content: ""
    }

    .ion-ios-keypad:before {
        content: ""
    }

    .ion-ios-keypad-outline:before {
        content: ""
    }

    .ion-ios-lightbulb:before {
        content: ""
    }

    .ion-ios-lightbulb-outline:before {
        content: ""
    }

    .ion-ios-list:before {
        content: ""
    }

    .ion-ios-list-outline:before {
        content: ""
    }

    .ion-ios-location:before {
        content: ""
    }

    .ion-ios-location-outline:before {
        content: ""
    }

    .ion-ios-locked:before {
        content: ""
    }

    .ion-ios-locked-outline:before {
        content: ""
    }

    .ion-ios-loop:before {
        content: ""
    }

    .ion-ios-loop-strong:before {
        content: ""
    }

    .ion-ios-medical:before {
        content: ""
    }

    .ion-ios-medical-outline:before {
        content: ""
    }

    .ion-ios-medkit:before {
        content: ""
    }

    .ion-ios-medkit-outline:before {
        content: ""
    }

    .ion-ios-mic:before {
        content: ""
    }

    .ion-ios-mic-off:before {
        content: ""
    }

    .ion-ios-mic-outline:before {
        content: ""
    }

    .ion-ios-minus:before {
        content: ""
    }

    .ion-ios-minus-empty:before {
        content: ""
    }

    .ion-ios-minus-outline:before {
        content: ""
    }

    .ion-ios-monitor:before {
        content: ""
    }

    .ion-ios-monitor-outline:before {
        content: ""
    }

    .ion-ios-moon:before {
        content: ""
    }

    .ion-ios-moon-outline:before {
        content: ""
    }

    .ion-ios-more:before {
        content: ""
    }

    .ion-ios-more-outline:before {
        content: ""
    }

    .ion-ios-musical-note:before {
        content: ""
    }

    .ion-ios-musical-notes:before {
        content: ""
    }

    .ion-ios-navigate:before {
        content: ""
    }

    .ion-ios-navigate-outline:before {
        content: ""
    }

    .ion-ios-nutrition:before {
        content: ""
    }

    .ion-ios-nutrition-outline:before {
        content: ""
    }

    .ion-ios-paper:before {
        content: ""
    }

    .ion-ios-paper-outline:before {
        content: ""
    }

    .ion-ios-paperplane:before {
        content: ""
    }

    .ion-ios-paperplane-outline:before {
        content: ""
    }

    .ion-ios-partlysunny:before {
        content: ""
    }

    .ion-ios-partlysunny-outline:before {
        content: ""
    }

    .ion-ios-pause:before {
        content: ""
    }

    .ion-ios-pause-outline:before {
        content: ""
    }

    .ion-ios-paw:before {
        content: ""
    }

    .ion-ios-paw-outline:before {
        content: ""
    }

    .ion-ios-people:before {
        content: ""
    }

    .ion-ios-people-outline:before {
        content: ""
    }

    .ion-ios-person:before {
        content: ""
    }

    .ion-ios-person-outline:before {
        content: ""
    }

    .ion-ios-personadd:before {
        content: ""
    }

    .ion-ios-personadd-outline:before {
        content: ""
    }

    .ion-ios-photos:before {
        content: ""
    }

    .ion-ios-photos-outline:before {
        content: ""
    }

    .ion-ios-pie:before {
        content: ""
    }

    .ion-ios-pie-outline:before {
        content: ""
    }

    .ion-ios-pint:before {
        content: ""
    }

    .ion-ios-pint-outline:before {
        content: ""
    }

    .ion-ios-play:before {
        content: ""
    }

    .ion-ios-play-outline:before {
        content: ""
    }

    .ion-ios-plus:before {
        content: ""
    }

    .ion-ios-plus-empty:before {
        content: ""
    }

    .ion-ios-plus-outline:before {
        content: ""
    }

    .ion-ios-pricetag:before {
        content: ""
    }

    .ion-ios-pricetag-outline:before {
        content: ""
    }

    .ion-ios-pricetags:before {
        content: ""
    }

    .ion-ios-pricetags-outline:before {
        content: ""
    }

    .ion-ios-printer:before {
        content: ""
    }

    .ion-ios-printer-outline:before {
        content: ""
    }

    .ion-ios-pulse:before {
        content: ""
    }

    .ion-ios-pulse-strong:before {
        content: ""
    }

    .ion-ios-rainy:before {
        content: ""
    }

    .ion-ios-rainy-outline:before {
        content: ""
    }

    .ion-ios-recording:before {
        content: ""
    }

    .ion-ios-recording-outline:before {
        content: ""
    }

    .ion-ios-redo:before {
        content: ""
    }

    .ion-ios-redo-outline:before {
        content: ""
    }

    .ion-ios-refresh:before {
        content: ""
    }

    .ion-ios-refresh-empty:before {
        content: ""
    }

    .ion-ios-refresh-outline:before {
        content: ""
    }

    .ion-ios-reload:before {
        content: ""
    }

    .ion-ios-reverse-camera:before {
        content: ""
    }

    .ion-ios-reverse-camera-outline:before {
        content: ""
    }

    .ion-ios-rewind:before {
        content: ""
    }

    .ion-ios-rewind-outline:before {
        content: ""
    }

    .ion-ios-rose:before {
        content: ""
    }

    .ion-ios-rose-outline:before {
        content: ""
    }

    .ion-ios-search:before {
        content: ""
    }

    .ion-ios-search-strong:before {
        content: ""
    }

    .ion-ios-settings:before {
        content: ""
    }

    .ion-ios-settings-strong:before {
        content: ""
    }

    .ion-ios-shuffle:before {
        content: ""
    }

    .ion-ios-shuffle-strong:before {
        content: ""
    }

    .ion-ios-skipbackward:before {
        content: ""
    }

    .ion-ios-skipbackward-outline:before {
        content: ""
    }

    .ion-ios-skipforward:before {
        content: ""
    }

    .ion-ios-skipforward-outline:before {
        content: ""
    }

    .ion-ios-snowy:before {
        content: ""
    }

    .ion-ios-speedometer:before {
        content: ""
    }

    .ion-ios-speedometer-outline:before {
        content: ""
    }

    .ion-ios-star:before {
        content: ""
    }

    .ion-ios-star-half:before {
        content: ""
    }

    .ion-ios-star-outline:before {
        content: ""
    }

    .ion-ios-stopwatch:before {
        content: ""
    }

    .ion-ios-stopwatch-outline:before {
        content: ""
    }

    .ion-ios-sunny:before {
        content: ""
    }

    .ion-ios-sunny-outline:before {
        content: ""
    }

    .ion-ios-telephone:before {
        content: ""
    }

    .ion-ios-telephone-outline:before {
        content: ""
    }

    .ion-ios-tennisball:before {
        content: ""
    }

    .ion-ios-tennisball-outline:before {
        content: ""
    }

    .ion-ios-thunderstorm:before {
        content: ""
    }

    .ion-ios-thunderstorm-outline:before {
        content: ""
    }

    .ion-ios-time:before {
        content: ""
    }

    .ion-ios-time-outline:before {
        content: ""
    }

    .ion-ios-timer:before {
        content: ""
    }

    .ion-ios-timer-outline:before {
        content: ""
    }

    .ion-ios-toggle:before {
        content: ""
    }

    .ion-ios-toggle-outline:before {
        content: ""
    }

    .ion-ios-trash:before {
        content: ""
    }

    .ion-ios-trash-outline:before {
        content: ""
    }

    .ion-ios-undo:before {
        content: ""
    }

    .ion-ios-undo-outline:before {
        content: ""
    }

    .ion-ios-unlocked:before {
        content: ""
    }

    .ion-ios-unlocked-outline:before {
        content: ""
    }

    .ion-ios-upload:before {
        content: ""
    }

    .ion-ios-upload-outline:before {
        content: ""
    }

    .ion-ios-videocam:before {
        content: ""
    }

    .ion-ios-videocam-outline:before {
        content: ""
    }

    .ion-ios-volume-high:before {
        content: ""
    }

    .ion-ios-volume-low:before {
        content: ""
    }

    .ion-ios-wineglass:before {
        content: ""
    }

    .ion-ios-wineglass-outline:before {
        content: ""
    }

    .ion-ios-world:before {
        content: ""
    }

    .ion-ios-world-outline:before {
        content: ""
    }

    .ion-ipad:before {
        content: ""
    }

    .ion-iphone:before {
        content: ""
    }

    .ion-ipod:before {
        content: ""
    }

    .ion-jet:before {
        content: ""
    }

    .ion-key:before {
        content: ""
    }

    .ion-knife:before {
        content: ""
    }

    .ion-laptop:before {
        content: ""
    }

    .ion-leaf:before {
        content: ""
    }

    .ion-levels:before {
        content: ""
    }

    .ion-lightbulb:before {
        content: ""
    }

    .ion-link:before {
        content: ""
    }

    .ion-load-a:before {
        content: ""
    }

    .ion-load-b:before {
        content: ""
    }

    .ion-load-c:before {
        content: ""
    }

    .ion-load-d:before {
        content: ""
    }

    .ion-location:before {
        content: ""
    }

    .ion-lock-combination:before {
        content: ""
    }

    .ion-locked:before {
        content: ""
    }

    .ion-log-in:before {
        content: ""
    }

    .ion-log-out:before {
        content: ""
    }

    .ion-loop:before {
        content: ""
    }

    .ion-magnet:before {
        content: ""
    }

    .ion-male:before {
        content: ""
    }

    .ion-man:before {
        content: ""
    }

    .ion-map:before {
        content: ""
    }

    .ion-medkit:before {
        content: ""
    }

    .ion-merge:before {
        content: ""
    }

    .ion-mic-a:before {
        content: ""
    }

    .ion-mic-b:before {
        content: ""
    }

    .ion-mic-c:before {
        content: ""
    }

    .ion-minus:before {
        content: ""
    }

    .ion-minus-circled:before {
        content: ""
    }

    .ion-minus-round:before {
        content: ""
    }

    .ion-model-s:before {
        content: ""
    }

    .ion-monitor:before {
        content: ""
    }

    .ion-more:before {
        content: ""
    }

    .ion-mouse:before {
        content: ""
    }

    .ion-music-note:before {
        content: ""
    }

    .ion-navicon:before {
        content: ""
    }

    .ion-navicon-round:before {
        content: ""
    }

    .ion-navigate:before {
        content: ""
    }

    .ion-network:before {
        content: ""
    }

    .ion-no-smoking:before {
        content: ""
    }

    .ion-nuclear:before {
        content: ""
    }

    .ion-outlet:before {
        content: ""
    }

    .ion-paintbrush:before {
        content: ""
    }

    .ion-paintbucket:before {
        content: ""
    }

    .ion-paper-airplane:before {
        content: ""
    }

    .ion-paperclip:before {
        content: ""
    }

    .ion-pause:before {
        content: ""
    }

    .ion-person:before {
        content: ""
    }

    .ion-person-add:before {
        content: ""
    }

    .ion-person-stalker:before {
        content: ""
    }

    .ion-pie-graph:before {
        content: ""
    }

    .ion-pin:before {
        content: ""
    }

    .ion-pinpoint:before {
        content: ""
    }

    .ion-pizza:before {
        content: ""
    }

    .ion-plane:before {
        content: ""
    }

    .ion-planet:before {
        content: ""
    }

    .ion-play:before {
        content: ""
    }

    .ion-playstation:before {
        content: ""
    }

    .ion-plus:before {
        content: ""
    }

    .ion-plus-circled:before {
        content: ""
    }

    .ion-plus-round:before {
        content: ""
    }

    .ion-podium:before {
        content: ""
    }

    .ion-pound:before {
        content: ""
    }

    .ion-power:before {
        content: ""
    }

    .ion-pricetag:before {
        content: ""
    }

    .ion-pricetags:before {
        content: ""
    }

    .ion-printer:before {
        content: ""
    }

    .ion-pull-request:before {
        content: ""
    }

    .ion-qr-scanner:before {
        content: ""
    }

    .ion-quote:before {
        content: ""
    }

    .ion-radio-waves:before {
        content: ""
    }

    .ion-record:before {
        content: ""
    }

    .ion-refresh:before {
        content: ""
    }

    .ion-reply:before {
        content: ""
    }

    .ion-reply-all:before {
        content: ""
    }

    .ion-ribbon-a:before {
        content: ""
    }

    .ion-ribbon-b:before {
        content: ""
    }

    .ion-sad:before {
        content: ""
    }

    .ion-sad-outline:before {
        content: ""
    }

    .ion-scissors:before {
        content: ""
    }

    .ion-search:before {
        content: ""
    }

    .ion-settings:before {
        content: ""
    }

    .ion-share:before {
        content: ""
    }

    .ion-shuffle:before {
        content: ""
    }

    .ion-skip-backward:before {
        content: ""
    }

    .ion-skip-forward:before {
        content: ""
    }

    .ion-social-android:before {
        content: ""
    }

    .ion-social-android-outline:before {
        content: ""
    }

    .ion-social-angular:before {
        content: ""
    }

    .ion-social-angular-outline:before {
        content: ""
    }

    .ion-social-apple:before {
        content: ""
    }

    .ion-social-apple-outline:before {
        content: ""
    }

    .ion-social-bitcoin:before {
        content: ""
    }

    .ion-social-bitcoin-outline:before {
        content: ""
    }

    .ion-social-buffer:before {
        content: ""
    }

    .ion-social-buffer-outline:before {
        content: ""
    }

    .ion-social-chrome:before {
        content: ""
    }

    .ion-social-chrome-outline:before {
        content: ""
    }

    .ion-social-codepen:before {
        content: ""
    }

    .ion-social-codepen-outline:before {
        content: ""
    }

    .ion-social-css3:before {
        content: ""
    }

    .ion-social-css3-outline:before {
        content: ""
    }

    .ion-social-designernews:before {
        content: ""
    }

    .ion-social-designernews-outline:before {
        content: ""
    }

    .ion-social-dribbble:before {
        content: ""
    }

    .ion-social-dribbble-outline:before {
        content: ""
    }

    .ion-social-dropbox:before {
        content: ""
    }

    .ion-social-dropbox-outline:before {
        content: ""
    }

    .ion-social-euro:before {
        content: ""
    }

    .ion-social-euro-outline:before {
        content: ""
    }

    .ion-social-facebook:before {
        content: ""
    }

    .ion-social-facebook-outline:before {
        content: ""
    }

    .ion-social-foursquare:before {
        content: ""
    }

    .ion-social-foursquare-outline:before {
        content: ""
    }

    .ion-social-freebsd-devil:before {
        content: ""
    }

    .ion-social-github:before {
        content: ""
    }

    .ion-social-github-outline:before {
        content: ""
    }

    .ion-social-google:before {
        content: ""
    }

    .ion-social-google-outline:before {
        content: ""
    }

    .ion-social-googleplus:before {
        content: ""
    }

    .ion-social-googleplus-outline:before {
        content: ""
    }

    .ion-social-hackernews:before {
        content: ""
    }

    .ion-social-hackernews-outline:before {
        content: ""
    }

    .ion-social-html5:before {
        content: ""
    }

    .ion-social-html5-outline:before {
        content: ""
    }

    .ion-social-instagram:before {
        content: ""
    }

    .ion-social-instagram-outline:before {
        content: ""
    }

    .ion-social-javascript:before {
        content: ""
    }

    .ion-social-javascript-outline:before {
        content: ""
    }

    .ion-social-linkedin:before {
        content: ""
    }

    .ion-social-linkedin-outline:before {
        content: ""
    }

    .ion-social-markdown:before {
        content: ""
    }

    .ion-social-nodejs:before {
        content: ""
    }

    .ion-social-octocat:before {
        content: ""
    }

    .ion-social-pinterest:before {
        content: ""
    }

    .ion-social-pinterest-outline:before {
        content: ""
    }

    .ion-social-python:before {
        content: ""
    }

    .ion-social-reddit:before {
        content: ""
    }

    .ion-social-reddit-outline:before {
        content: ""
    }

    .ion-social-rss:before {
        content: ""
    }

    .ion-social-rss-outline:before {
        content: ""
    }

    .ion-social-sass:before {
        content: ""
    }

    .ion-social-skype:before {
        content: ""
    }

    .ion-social-skype-outline:before {
        content: ""
    }

    .ion-social-snapchat:before {
        content: ""
    }

    .ion-social-snapchat-outline:before {
        content: ""
    }

    .ion-social-tumblr:before {
        content: ""
    }

    .ion-social-tumblr-outline:before {
        content: ""
    }

    .ion-social-tux:before {
        content: ""
    }

    .ion-social-twitch:before {
        content: ""
    }

    .ion-social-twitch-outline:before {
        content: ""
    }

    .ion-social-twitter:before {
        content: ""
    }

    .ion-social-twitter-outline:before {
        content: ""
    }

    .ion-social-usd:before {
        content: ""
    }

    .ion-social-usd-outline:before {
        content: ""
    }

    .ion-social-vimeo:before {
        content: ""
    }

    .ion-social-vimeo-outline:before {
        content: ""
    }

    .ion-social-whatsapp:before {
        content: ""
    }

    .ion-social-whatsapp-outline:before {
        content: ""
    }

    .ion-social-windows:before {
        content: ""
    }

    .ion-social-windows-outline:before {
        content: ""
    }

    .ion-social-wordpress:before {
        content: ""
    }

    .ion-social-wordpress-outline:before {
        content: ""
    }

    .ion-social-yahoo:before {
        content: ""
    }

    .ion-social-yahoo-outline:before {
        content: ""
    }

    .ion-social-yen:before {
        content: ""
    }

    .ion-social-yen-outline:before {
        content: ""
    }

    .ion-social-youtube:before {
        content: ""
    }

    .ion-social-youtube-outline:before {
        content: ""
    }

    .ion-soup-can:before {
        content: ""
    }

    .ion-soup-can-outline:before {
        content: ""
    }

    .ion-speakerphone:before {
        content: ""
    }

    .ion-speedometer:before {
        content: ""
    }

    .ion-spoon:before {
        content: ""
    }

    .ion-star:before {
        content: ""
    }

    .ion-stats-bars:before {
        content: ""
    }

    .ion-steam:before {
        content: ""
    }

    .ion-stop:before {
        content: ""
    }

    .ion-thermometer:before {
        content: ""
    }

    .ion-thumbsdown:before {
        content: ""
    }

    .ion-thumbsup:before {
        content: ""
    }

    .ion-toggle:before {
        content: ""
    }

    .ion-toggle-filled:before {
        content: ""
    }

    .ion-transgender:before {
        content: ""
    }

    .ion-trash-a:before {
        content: ""
    }

    .ion-trash-b:before {
        content: ""
    }

    .ion-trophy:before {
        content: ""
    }

    .ion-tshirt:before {
        content: ""
    }

    .ion-tshirt-outline:before {
        content: ""
    }

    .ion-umbrella:before {
        content: ""
    }

    .ion-university:before {
        content: ""
    }

    .ion-unlocked:before {
        content: ""
    }

    .ion-upload:before {
        content: ""
    }

    .ion-usb:before {
        content: ""
    }

    .ion-videocamera:before {
        content: ""
    }

    .ion-volume-high:before {
        content: ""
    }

    .ion-volume-low:before {
        content: ""
    }

    .ion-volume-medium:before {
        content: ""
    }

    .ion-volume-mute:before {
        content: ""
    }

    .ion-wand:before {
        content: ""
    }

    .ion-waterdrop:before {
        content: ""
    }

    .ion-wifi:before {
        content: ""
    }

    .ion-wineglass:before {
        content: ""
    }

    .ion-woman:before {
        content: ""
    }

    .ion-wrench:before {
        content: ""
    }

    .ion-xbox:before {
        content: ""
    }

    .tooltipster-default {
        border-radius: 5px;
        background: #0075bc;
        color: #fff
    }

    .tooltipster-default .tooltipster-content {
        font-size: 14px;
        line-height: 16px;
        padding: 8px 10px;
        overflow: hidden
    }

    .tooltipster-icon {
        cursor: help;
        margin-left: 4px
    }

    .tooltipster-base {
        padding: 0;
        font-size: 0;
        line-height: 0;
        position: absolute;
        left: 0;
        top: 0;
        z-index: 9999999;
        pointer-events: none;
        width: auto;
        overflow: visible
    }

    .tooltipster-base .tooltipster-content {
        overflow: hidden
    }

    .tooltipster-arrow {
        display: block;
        text-align: center;
        width: 100%;
        height: 100%;
        position: absolute;
        top: 0;
        left: 0;
        z-index: -1
    }

    .tooltipster-arrow-border,
    .tooltipster-arrow span {
        display: block;
        width: 0;
        height: 0;
        position: absolute
    }

    .tooltipster-arrow-top-left span,
    .tooltipster-arrow-top-right span,
    .tooltipster-arrow-top span {
        border-left: 8px solid transparent!important;
        border-right: 8px solid transparent!important;
        border-top: 8px solid;
        bottom: -7px
    }

    .tooltipster-arrow-top-left .tooltipster-arrow-border,
    .tooltipster-arrow-top-right .tooltipster-arrow-border,
    .tooltipster-arrow-top .tooltipster-arrow-border {
        border-left: 9px solid transparent!important;
        border-right: 9px solid transparent!important;
        border-top: 9px solid;
        bottom: -7px
    }

    .tooltipster-arrow-bottom-left span,
    .tooltipster-arrow-bottom-right span,
    .tooltipster-arrow-bottom span {
        border-left: 8px solid transparent!important;
        border-right: 8px solid transparent!important;
        border-bottom: 8px solid;
        top: -7px
    }

    .tooltipster-arrow-bottom-left .tooltipster-arrow-border,
    .tooltipster-arrow-bottom-right .tooltipster-arrow-border,
    .tooltipster-arrow-bottom .tooltipster-arrow-border {
        border-left: 9px solid transparent!important;
        border-right: 9px solid transparent!important;
        border-bottom: 9px solid;
        top: -7px
    }

    .tooltipster-arrow-bottom .tooltipster-arrow-border,
    .tooltipster-arrow-bottom span,
    .tooltipster-arrow-top .tooltipster-arrow-border,
    .tooltipster-arrow-top span {
        left: 0;
        right: 0;
        margin: 0 auto
    }

    .tooltipster-arrow-bottom-left span,
    .tooltipster-arrow-top-left span {
        left: 6px
    }

    .tooltipster-arrow-bottom-left .tooltipster-arrow-border,
    .tooltipster-arrow-top-left .tooltipster-arrow-border {
        left: 5px
    }

    .tooltipster-arrow-bottom-right span,
    .tooltipster-arrow-top-right span {
        right: 6px
    }

    .tooltipster-arrow-bottom-right .tooltipster-arrow-border,
    .tooltipster-arrow-top-right .tooltipster-arrow-border {
        right: 5px
    }

    .tooltipster-arrow-left .tooltipster-arrow-border,
    .tooltipster-arrow-left span {
        border-top: 8px solid transparent!important;
        border-bottom: 8px solid transparent!important;
        border-left: 8px solid;
        top: 50%;
        margin-top: -7px;
        right: -7px
    }

    .tooltipster-arrow-left .tooltipster-arrow-border {
        border-top: 9px solid transparent!important;
        border-bottom: 9px solid transparent!important;
        border-left: 9px solid;
        margin-top: -8px
    }

    .tooltipster-arrow-right .tooltipster-arrow-border,
    .tooltipster-arrow-right span {
        border-top: 8px solid transparent!important;
        border-bottom: 8px solid transparent!important;
        border-right: 8px solid;
        top: 50%;
        margin-top: -7px;
        left: -7px
    }

    .tooltipster-arrow-right .tooltipster-arrow-border {
        border-top: 9px solid transparent!important;
        border-bottom: 9px solid transparent!important;
        border-right: 9px solid;
        margin-top: -8px
    }

    .tooltipster-fade {
        opacity: 0;
        transition-property: opacity
    }

    .tooltipster-fade-show {
        opacity: 1
    }

    .tooltipster-grow {
        transform: scale(0);
        transition-property: transform;
        -webkit-backface-visibility: hidden
    }

    .tooltipster-grow-show {
        transform: scale(1);
        transition-timing-function: cubic-bezier(.175, .885, .32, 1.15)
    }

    .tooltipster-swing {
        opacity: 0;
        transform: rotate(4deg);
        transition-property: transform
    }

    .tooltipster-swing-show {
        opacity: 1;
        transform: rotate(0deg);
        transition-timing-function: cubic-bezier(.23, .635, .495, 2.4)
    }

    .tooltipster-fall {
        top: 0;
        transition-property: top;
        transition-timing-function: cubic-bezier(.175, .885, .32, 1.15)
    }

    .tooltipster-fall.tooltipster-dying {
        transition-property: all;
        top: 0!important;
        opacity: 0
    }

    .tooltipster-slide {
        left: -40px;
        transition-property: left;
        transition-timing-function: cubic-bezier(.175, .885, .32, 1.15)
    }

    .tooltipster-slide.tooltipster-dying {
        transition-property: all;
        left: 0!important;
        opacity: 0
    }

    .tooltipster-content-changing {
        opacity: .5;
        transform: scale(1.1)
    }

    .tooltipster-light {
        border-radius: 5px;
        border: 1px solid #ccc;
        background: #ededed;
        color: #666
    }

    .tooltipster-light .tooltipster-content {
        font-family: Arial, sans-serif;
        font-size: 14px;
        line-height: 16px;
        padding: 8px 10px
    }

    .owl-carousel,
    .owl-carousel .owl-item {
        -webkit-tap-highlight-color: transparent;
        position: relative
    }

    .owl-carousel {
        display: none;
        width: 100%;
        z-index: 1
    }

    .owl-carousel .owl-stage {
        position: relative;
        -ms-touch-action: pan-Y
    }

    .owl-carousel .owl-stage:after {
        content: ".";
        display: block;
        clear: both;
        visibility: hidden;
        line-height: 0;
        height: 0
    }

    .owl-carousel .owl-stage-outer {
        position: relative;
        overflow: hidden;
        -webkit-transform: translateZ(0)
    }

    .owl-carousel .owl-item {
        min-height: 1px;
        float: left;
        -webkit-backface-visibility: hidden;
        -webkit-touch-callout: none
    }

    .owl-carousel .owl-item img {
        display: block;
        width: 100%;
        -webkit-transform-style: preserve-3d
    }

    .owl-carousel .owl-dots.disabled,
    .owl-carousel .owl-nav.disabled {
        display: none
    }

    .no-js .owl-carousel,
    .owl-carousel.owl-loaded {
        display: block
    }

    .owl-carousel .owl-dot,
    .owl-carousel .owl-nav .owl-next,
    .owl-carousel .owl-nav .owl-prev {
        cursor: pointer;
        cursor: hand;
        -webkit-user-select: none;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none
    }

    .owl-carousel.owl-loading {
        opacity: 0;
        display: block
    }

    .owl-carousel.owl-hidden {
        opacity: 0
    }

    .owl-carousel.owl-refresh .owl-item {
        visibility: hidden
    }

    .owl-carousel.owl-drag .owl-item {
        -webkit-user-select: none;
        -moz-user-select: none;
        -ms-user-select: none;
        user-select: none
    }

    .owl-carousel.owl-grab {
        cursor: move;
        cursor: -webkit-grab;
        cursor: grab
    }

    .owl-carousel.owl-rtl {
        direction: rtl
    }

    .owl-carousel.owl-rtl .owl-item {
        float: right
    }

    .owl-carousel .animated {
        animation-duration: 1s;
        animation-fill-mode: both
    }

    .owl-carousel .owl-animated-in {
        z-index: 0
    }

    .owl-carousel .owl-animated-out {
        z-index: 1
    }

    .owl-carousel .fadeOut {
        animation-name: d
    }

    .owl-height {
        transition: height .5s ease-in-out
    }

    .owl-carousel .owl-item .owl-lazy {
        opacity: 0;
        transition: opacity .4s ease
    }

    .owl-carousel .owl-item img.owl-lazy {
        transform-style: preserve-3d
    }

    .owl-carousel .owl-video-wrapper {
        position: relative;
        height: 100%;
        background: #000
    }

    .owl-carousel .owl-video-play-icon {
        position: absolute;
        height: 80px;
        width: 80px;
        left: 50%;
        top: 50%;
        margin-left: -40px;
        margin-top: -40px;
        background: url(../owl.video.play.png) no-repeat;
        cursor: pointer;
        z-index: 1;
        -webkit-backface-visibility: hidden;
        transition: transform .1s ease
    }

    .owl-carousel .owl-video-play-icon:hover {
        transform: scale(1.3)
    }

    .owl-carousel .owl-video-playing .owl-video-play-icon,
    .owl-carousel .owl-video-playing .owl-video-tn {
        display: none
    }

    .owl-carousel .owl-video-tn {
        opacity: 0;
        height: 100%;
        background-position: center center;
        background-repeat: no-repeat;
        background-size: contain;
        transition: opacity .4s ease
    }

    .owl-carousel .owl-video-frame {
        position: relative;
        z-index: 1;
        height: 100%;
        width: 100%
    }

    html.remodal-is-locked {
        overflow: hidden;
        -ms-touch-action: none;
        touch-action: none
    }

    .remodal,
    [data-remodal-id] {
        display: none
    }

    .remodal-overlay {
        position: fixed;
        z-index: 9999;
        top: -5000px;
        right: -5000px;
        bottom: -5000px;
        left: -5000px;
        display: none
    }

    .remodal-wrapper {
        position: fixed;
        z-index: 10000;
        top: 0;
        right: 0;
        bottom: 0;
        left: 0;
        display: none;
        overflow: auto;
        text-align: center;
        -webkit-overflow-scrolling: touch
    }

    .remodal-wrapper:after {
        display: inline-block;
        height: 100%;
        margin-left: -.05em;
        content: ""
    }

    .remodal-overlay,
    .remodal-wrapper {
        -webkit-backface-visibility: hidden;
        backface-visibility: hidden
    }

    .remodal {
        position: relative;
        outline: none;
        -webkit-text-size-adjust: 100%;
        -ms-text-size-adjust: 100%;
        text-size-adjust: 100%
    }

    .remodal-is-initialized {
        display: inline-block
    }

    .remodal-bg.remodal-is-opened,
    .remodal-bg.remodal-is-opening {
        -webkit-filter: blur(3px);
        filter: blur(3px)
    }

    .remodal-overlay {
        background: rgba(43, 46, 56, .9)
    }

    .remodal-overlay.remodal-is-closing,
    .remodal-overlay.remodal-is-opening {
        animation-duration: .3s;
        animation-fill-mode: forwards
    }

    .remodal-overlay.remodal-is-opening {
        animation-name: c
    }

    .remodal-overlay.remodal-is-closing {
        animation-name: d
    }

    .remodal-wrapper {
        padding: 10px 10px 0
    }

    .remodal {
        box-sizing: border-box;
        width: 100%;
        margin-bottom: 10px;
        padding: 35px;
        transform: translateZ(0);
        color: #2b2e38;
        background: #fff
    }

    .remodal.remodal-is-closing,
    .remodal.remodal-is-opening {
        animation-duration: .3s;
        animation-fill-mode: forwards
    }

    .remodal.remodal-is-opening {
        animation-name: a
    }

    .remodal.remodal-is-closing {
        animation-name: b
    }

    .remodal,
    .remodal-wrapper:after {
        vertical-align: middle
    }

    .remodal-close {
        position: absolute;
        top: 0;
        left: 0;
        display: block;
        overflow: visible;
        width: 35px;
        height: 35px;
        margin: 0;
        padding: 0;
        cursor: pointer;
        transition: color .2s;
        text-decoration: none;
        color: #95979c;
        border: 0;
        outline: 0;
        background: transparent
    }

    .remodal-close:focus,
    .remodal-close:hover {
        color: #2b2e38
    }

    .remodal-close:before {
        font-family: Arial, Helvetica CY, Nimbus Sans L, sans-serif!important;
        font-size: 25px;
        line-height: 35px;
        position: absolute;
        top: 0;
        left: 0;
        display: block;
        width: 35px;
        content: "×";
        text-align: center
    }

    .remodal-cancel,
    .remodal-confirm {
        font: inherit;
        display: inline-block;
        overflow: visible;
        min-width: 110px;
        margin: 0;
        padding: 12px 0;
        cursor: pointer;
        transition: background .2s;
        text-align: center;
        vertical-align: middle;
        text-decoration: none;
        border: 0;
        outline: 0
    }

    .remodal-confirm {
        color: #fff;
        background: #81c784
    }

    .remodal-confirm:focus,
    .remodal-confirm:hover {
        background: #66bb6a
    }

    .remodal-cancel {
        color: #fff;
        background: #e57373
    }

    .remodal-cancel:focus,
    .remodal-cancel:hover {
        background: #ef5350
    }

    .remodal-cancel::-moz-focus-inner,
    .remodal-close::-moz-focus-inner,
    .remodal-confirm::-moz-focus-inner {
        padding: 0;
        border: 0
    }

    @keyframes a {
        0% {
            transform: scale(1.05);
            opacity: 0
        }
        to {
            transform: none;
            opacity: 1
        }
    }

    @keyframes b {
        0% {
            transform: scale(1);
            opacity: 1
        }
        to {
            transform: scale(.95);
            opacity: 0
        }
    }

    @keyframes c {
        0% {
            opacity: 0
        }
        to {
            opacity: 1
        }
    }

    @keyframes d {
        0% {
            opacity: 1
        }
        to {
            opacity: 0
        }
    }

    @media only screen and (min-width:641px) {
        .remodal {
            max-width: 700px
        }
    }

    .lt-ie9 .remodal-overlay {
        background: #2b2e38
    }

    .lt-ie9 .remodal {
        width: 700px
    }

    .pagination {
        display: inline-block;
        padding-left: 0;
        margin: 20px 0;
        border-radius: 4px
    }

    .pagination > li {
        display: inline
    }

    .pagination > li > a,
    .pagination > li > span {
        position: relative;
        float: left;
        padding: 6px 12px;
        margin-left: -1px;
        line-height: 1.428571429;
        text-decoration: none;
        background-color: #fff;
        border: 1px solid #ddd
    }

    .pagination > li:first-child > a,
    .pagination > li:first-child > span {
        margin-left: 0;
        border-bottom-left-radius: 4px;
        border-top-left-radius: 4px
    }

    .pagination > li:last-child > a,
    .pagination > li:last-child > span {
        border-top-right-radius: 4px;
        border-bottom-right-radius: 4px
    }

    .pagination > li > a:focus,
    .pagination > li > a:hover,
    .pagination > li > span:focus,
    .pagination > li > span:hover {
        background-color: #eee
    }

    .pagination > .active > a,
    .pagination > .active > a:focus,
    .pagination > .active > a:hover,
    .pagination > .active > span,
    .pagination > .active > span:focus,
    .pagination > .active > span:hover {
        z-index: 2;
        color: #fff;
        cursor: default;
        background-color: #428bca;
        border-color: #428bca
    }

    .pagination > .disabled > a,
    .pagination > .disabled > a:focus,
    .pagination > .disabled > a:hover,
    .pagination > .disabled > span {
        color: #999;
        cursor: not-allowed;
        background-color: #fff;
        border-color: #ddd
    }

    .pagination-lg > li > a,
    .pagination-lg > li > span {
        padding: 10px 16px;
        font-size: 18px
    }

    .pagination-lg > li:first-child > a,
    .pagination-lg > li:first-child > span {
        border-bottom-left-radius: 6px;
        border-top-left-radius: 6px
    }

    .pagination-lg > li:last-child > a,
    .pagination-lg > li:last-child > span {
        border-top-right-radius: 6px;
        border-bottom-right-radius: 6px
    }

    .pagination-sm > li > a,
    .pagination-sm > li > span {
        padding: 5px 10px;
        font-size: 12px
    }

    .pagination-sm > li:first-child > a,
    .pagination-sm > li:first-child > span {
        border-bottom-left-radius: 3px;
        border-top-left-radius: 3px
    }

    .pagination-sm > li:last-child > a,
    .pagination-sm > li:last-child > span {
        border-top-right-radius: 3px;
        border-bottom-right-radius: 3px
    }

    .pager {
        padding-left: 0;
        margin: 20px 0;
        text-align: center;
        list-style: none
    }

    .pager:after,
    .pager:before {
        display: table;
        content: " "
    }

    .pager:after {
        clear: both
    }

    .pager li {
        display: inline
    }

    .pager li > a,
    .pager li > span {
        display: inline-block;
        padding: 5px 14px;
        background-color: #fff;
        border: 1px solid #ddd;
        border-radius: 15px
    }

    .pager li > a:focus,
    .pager li > a:hover {
        text-decoration: none;
        background-color: #eee
    }

    .pager .next > a,
    .pager .next > span {
        float: right
    }

    .pager .previous > a,
    .pager .previous > span {
        float: left
    }

    .pager .disabled > a,
    .pager .disabled > a:focus,
    .pager .disabled > a:hover,
    .pager .disabled > span {
        color: #999;
        cursor: not-allowed;
        background-color: #fff
    }

    .map {
        width: 100%;
        height: 400px;
        background-color: grey
    }
    @font-face {
        font-family: Ionicons;
        src: url(Brandon_bld.otf);
        font-weight: 400;
        font-style: normal
        
    }
    .discipline:hover{
        cursor: pointer;
        background-color: #B1F9FE;
    }

    /*
    drag and drop
     */
    .sortable-tr{
        cursor: move;
    }
    .save_order{
        display: none;
    }
    table.floatThead-table {
        border-top: none;
        border-bottom: none;
        background-color: #fff;
    }

    .ui.modal{
        position: absolute;
        top:50%;
        left: 50%;
        transform: translate(-50%, -50%);
        transition: .2s;
    }
    .card_button{
        height:50px;
    }
    .match_bold{
        font-weight: bold;
    }
    .pointer_star{
        cursor: all-scroll;
    }
    .pointer_hand{
        cursor:pointer;
    }

    /*
    Claudiu modificari
     */
    .menu-side {
        position: fixed;
        top: 0;
        left: 0;
        width: calc(100% - 95%);
        height: 100%;
        z-index: 1002;
        transition: .3s;
    }

    .menu-expand {
        width: 20%;
    }

    .disable {
        opacity: 0;
        pointer-events: none;
        transition: .5s;
    }

    .not-show {
        display: none;
        opacity: 0;
        transition: .5s;
        transition-delay: .3s;
    }

    .not-show-active {
        display: inline;
        animation: showw .5s ease-in forwards;
        transition: .5s;
    }

    @keyframes showw{
        0%{
            opacity: 0;
        }
        100%{
            opacity: 1;
        }
    }

    .fixed-width {
        width: calc(100% - 5%);
    }

    .sesam-deschide-te {
        font-size: 34px;
        position: absolute;
        top: 50%;
        right: -105px;
        transform: translateX(-50%);
        z-index: 2;
        cursor: pointer;
    }

    .positions {
        right: 0px;
        transform: rotate(180deg);
    }

    .continut-toggle {
        position: relative;
        width: 70px;
        height: 70px;
        border: 1px solid #212125;
        background: #212125;
        transition: .3s;
        -webkit-clip-path: polygon(0 0, 25% 20%, 25% 80%, 0% 100%);
        clip-path: polygon(0 0, 25% 20%, 25% 80%, 0% 100%);
        /*overflow: hidden;*/
    }

    .continut-toggle:before {
        content: '';
        width: 10px;
        height: 40px;
        position: absolute;
        top: 50%;
        left: 0;
        transform: translate(10%, -50%);
        transition: .3s;
        border-top-right-radius: 20%;
        border-bottom-right-radius: 20%;
        border:2px solid #212125;
        border-right-color:  white;
    }
    .continut-toggle:after {
        content: '';
        width: 7px;
        height: 30px;
        position: absolute;
        top: 50%;
        left: 0;
        transform: translate(-30%, -50%);
        border: 1px solid #212125;
        transition: .3s;
        border-top-right-radius: 20%;
        border-bottom-right-radius: 20%;
        border:2px solid #212125;
        border-right-color:  white;
    }

    .t-active {
        background: white;
        border: 1px solid white;
        transition: .3s;
    }

    .t-active:before {
        content: '';
        transition: .3s;
        top: 50%;
        left: 0;
        transform: translate(0%, -50%);
        border-top-right-radius: 20%;
        border-bottom-right-radius: 20%;
        border:2px solid white;
        border-right-color:  black;
    }
    .t-active:after {
        content: '';
        transition: .3s;
        top: 50%;
        left: 0;
        transform: translate(-30%, -50%);
        border-top-right-radius: 20%;
        border-bottom-right-radius: 20%;
        border:2px solid white;
        border-right-color:  black;
    }

    /*
    modificari semantic - event call
    */

    .ui.header > .image + .content, .ui.header > img + .content{
        font-size: 16px;
    }
    .ui.circular.image, .ui.circular.image > *, .ui.circular.images .image, .ui.circular.images .image {
        border-radius: 50%;
    }
    .ui.header > .image:not(.icon), .ui.header > img{
        height: 2.5em;
    }
    .mini-semantic{
        padding: 30px 25px!important;
    }

      /*
      bara de informatii fixa
      */

    .add-padding-bot{
        padding: 36px 0 70px 5%;
    }

    .info-structure{
        position: fixed;
        width: 100%;
        height: 400px;
        display: block;
        z-index: 1003;
        bottom:0;
        left: 0;
        padding: 20px;
        background:#0097e1;
        transition: all .2s ease-in-out;
    }
    .is-icon{
        position: relative;
        /*display: inline-flex;*/
        display: none;
        vertical-align: top;
        width: 6%;
        text-align: center;
        height: 100%;
        padding: .6% 0  .6% 31px;
        align-items: center;
    }
    .is-icon i{
        color: white;
        font-size: 30px ;
    }
    .is-text{
        position: relative;
        display: inline-flex;
        width: calc(85% - 31px);
        height: 100%;
        vertical-align: top;
        align-items: top;
        padding: 0.6% 1%;
        overflow: auto;
        flex-direction: row;
        transition: all .2s ease-in-out;
    }
    .is-text::-webkit-scrollbar-track {
        background: rgba(0, 0, 0, .1);
        border-radius: 0;
    }
    .is-text::-webkit-scrollbar-thumb {
        cursor: pointer;
        border-radius: 5px;
        background: rgba(0, 0, 0, .25);
        -webkit-transition: color .2s ease;
        transition: color .2s ease;
    }
    .is-text::selection {
        background-color: #cce2ff;
        color: rgba(0, 0, 0, .87);
    }
    .is-text::-webkit-scrollbar {
        -webkit-appearance: none;
        width: 10px;
        height: 10px;
    }
    .is-text .table td,
    .is-text .table th{
        padding: 3px;
        color: white;
    }
    .is-text .table{
        width: 50%;
    }
    .is-text .table thead{
        border-bottom: 1px solid white;
    }
    .is-text .table tr:last-child{
        border-bottom: 1px solid white;
    }
    .is-text .p{
        width: 50%;
        line-height: 1.6;
        color: white;
        font-size: 17px;
    }
    .is-text .p .clw-title{
        width: 100%;
        color: white;
        font-weight: 600;
        cursor: pointer;
    }
    .is-text .p .clw-list p{
        color:white;
        font-size: 16px;
        font-weight: 400;
    }
    .is-text .p .clw-list ul li{
        font-weight: 400;
        cursor: pointer;
        font-size: 16px;
    }
    .is-buttons{
        position: relative;
        display: inline-flex;
        flex-direction: column;
        justify-content: center;
        align-items: center;
        width: 15%;
        height: 100%;
        padding: 0.5% 1%;
    }
    .is-b-front{
        transition: .5s ease;
        display: inline-block;
        width: 79%;
        padding: 1% 1%;
        margin: 10px 0;
        margin-block-end: 0;
        text-align: center;
    }
    .is-b-front input{
        transition: .5s ease;
        width: auto;
        height: 27px;
        font-size: 14px;
        border: 1px solid rgb(0,117,188);
        font-weight: 600;
        color: #46cae9;
        background: rgb(0,117,188);
        padding: 1% 5%;
        border-radius: 1000px;
        text-transform: uppercase;
    }
    .is-b-front input:hover{
        border: 1px solid transparent;
        color: white;
    }
    .is-b-back{
        transition: .5s ease;
        display: inline-block;
        width: 79%;
        padding: 1% 1%;
        margin: 10px 0;
        text-align: center;
    }
    .is-b-back .is-b-link{
        transition: .5s ease;
        width: auto;
        height: 27px;
        font-size: 14px;
        border: 1px solid transparent;
        font-weight: 600;
        color: #46cae9;
        background: rgb(0,117,188);
        padding: 1% 5%;
        border-radius: 1000px;
        -ms-word-break: break-all;
        text-transform: uppercase;
    }
    .is-b-back .is-b-link:hover{
        color: white;
        border: 1px solid rgb(0,117,188);
    }
    .show{
        position: fixed;
        bottom: 385px;
        left: 50%;
        transform: translateX(-50%);
        display: inline-block;
        vertical-align: middle;
        text-align: center;
        color:white;
        font-size: 15px;
        line-height: 3;
        background: rgb(0,117,188);
        -webkit-border-radius: 50%;
        -moz-border-radius: 50%;
        border-radius: 50%;
        width: 31px;
        padding: 8.8px;
        height: 31px;
        cursor:pointer;
        z-index: 1;
        transition: all .2s ease-in-out;
    }
    .show:hover{
        background: white;
        color: black;
    }
    .show:before{
        content:'';
        position: fixed;
        top:50%;
        left: 50%;
        transform: translate(-50% ,-50%);
        width: 42px;
        height: 42px;
        background: #0097e1;
        mix-blend-mode: screen;
        border-radius: 50%;
        cursor:pointer;
    }
    .info-structure.hidden{
        padding: 5px 0 0 0;
        width: 100%;
        height: 60px;
    }
    .info-structure.hidden .show{
        bottom: 40px;
        padding: 10.2px 0;
        transform: rotate(180deg);
    }
    .info-structure.hidden .is-text{
        display: none;
    }
    .info-structure.hidden .is-buttons{
        display: inline-block;
        float: right;
        width: 30%;
        padding: 0;
    }
    .info-structure.hidden .is-buttons .is-b-back{
        width: 40.5%;
    }
    .info-structure.hidden .is-buttons .is-b-front{
        width: 40.5%;
    }
    .info-structure.hidden .is-icon{
        display: inline-flex;
    }
        /*
        modificari marius
        */

    .check.large.circle.outline.icon{
        cursor:pointer;
    }
    .days{
        cursor:pointer;
    }
    .rest{
        position: fixed;
        bottom:0;
        right: 0;
    }

    input[type=number]::-webkit-inner-spin-button,
    input[type=number]::-webkit-outer-spin-button {
        -webkit-appearance: none;
        -moz-appearance: none;
        appearance: none;
        margin: 0;
    }

    .blue{
        color: #0075bc;
    }

    #sticky-header{
        overflow-x: auto;
    }

    .div_marius{
        max-width:1580px!important;
        overflow: auto;
    }

    @media screen and (max-width: 1625px){
        .div_marius{
            max-width: 1200px!important;
        }
        .menu-side .nav__item{
            margin-left: -4.3%;
        }
        .menu-expand .nav__item{
            margin-left: 0;
        }

        .is-text{
            width: 81%;
            padding: 0.6% 1%;
        }
        .is-text p{
            font-size: 16px;
        }
        .is-buttons{
            width: 15%;
        }
        .is-text  .clw-list li{
            font-size: 14px;
            font-weight: 400;
        }
        .is-b-front input{
            padding: 1% 4%;
        }

        .is-b-back .is-b-link{
            padding: 1% 4%;
        }

    }

    @media screen and (max-width: 1440px){
        .div_marius{
            max-width: 1100px!important;
        }
        .menu-side .nav__item{
            margin-left: -10%;
        }
        .menu-expand .nav__item{
            margin-left: 0;
        }

        .is-text{
            width: 85%;
            padding: 0.6% 1%;
        }
        .is-text p{
            font-size: 15px;
        }
        .is-buttons{
            width: 13%;
        }
        .is-b-back{
            width: 100%;
        }
        .is-b-front{
            width: 100%;
        }
        .is-b-front input{
            padding: .7% 3%;
        }

        .is-b-back .is-b-link{
            padding: .7% 3%;
        }
    }

    @media screen and (max-width: 1310px){
        .div_marius{
            max-width: 1000px!important;
        }
        .menu-side .nav__item{
            margin-left: -15%;
        }
        .menu-expand .nav__item{
            margin-left: 0;
        }
    }

    @media screen and (max-width: 1200px){
        .div_marius{
            max-width: 900px!important;
        }
        .menu-side .nav__item{
            margin-left: -23.5%;
        }
        .menu-expand .nav__item{
            margin-left: 0;
        }
    }

    @media screen and (max-width: 1100px){
        .div_marius{
            max-width: 800px!important;
        }
        .menu-side .nav__item{
            margin-left: -28.3%;
        }
        .menu-expand .nav__item{
            margin-left: 0;
        }
    }

    /* FOOTER CA PE PAGINA PRINCIPALA */

    .smm__link img{
        transform:translateY(6px);
    }

    .disabled-announce{
        /*pointer-events: none;*/
        cursor: not-allowed;
    }
    .disabled-announce:hover{
        background-color:#ff0033;
        border: 1px solid #ff0033;
    }
    .disabled-announce:visited{
        background-color:#ff0033;
        border: 1px solid #0075bc;
    }

    /*  Lista marius ORG requirements.php */

.clw-title{
    font-size: 21px;
    line-height: 28px;
    font-weight: 700;
    letter-spacing: .05em;
}
.clw-list{
    margin-left: 30px;
    font-size: 19px;
}
.clw-list p{
    color: #505c69;
    text-transform: none;
    font-size: 19px;
    line-height: 28px;
    font-weight: 700;
    letter-spacing: .05em;
    padding: 10px 10px 10px 5px;
    display: initial;
    cursor: pointer;
}
.clw-list p:hover{
    text-decoration: underline;
    color: #505c69;
}
.clw-list li{
    display: list-item;
    font-size: 21px;
    line-height: 28px;
    font-weight: 700;
    letter-spacing: .05em;
}
.clw-list li:before {
    content: "-";
}
.clw-spaced{
    width: 100%;
}
.clw-spaced tr{
    margin: 0 13px  0 0;
    padding: 0 ;
}
.td-vertical-align-middle{
    vertical-align: middle;
}

/**
    Marius pt announce AIDA-
     */
#aida_readonly{
    position:absolute;
    top:131px;
    left:63px;
    color: #888;
}
#aida_readonly_edit{
    position:absolute;
    top:163px;
    left:36px;
    color: #888;
}

/**
Marius pt announce AIDA-
 */

/* schimbare - modal branding (apare imaginea in modal)  04.12.2019 */

#opened-modal img {
    position: fixed;
    top:50%;
    left:50%;
    transform: translate(-50%,-50%);
    margin: 0;
    padding: 0;
}
#open-modal{
    position: relative;
    cursor:pointer;
}
#open-modal:hover img{
    border:5px solid #0075bc;
    opacity: .5;
    z-index: -1;

}

.in-page,
.in-page i.icon{
    color: black!important;
}

.ui.checkbox input[type=checkbox], .ui.checkbox input[type=radio] {
    opacity: 1 !important;
}